The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24274197 ID: ALA1604590
PubChem CID: 2938115
Max Phase: Preclinical
Molecular Formula: C21H18BrNO5
Molecular Weight: 444.28
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN1C(=O)C(O)(CC(=O)c2ccc(OC)c(OC)c2)c2cc(Br)ccc21
Standard InChI: InChI=1S/C21H18BrNO5/c1-4-9-23-16-7-6-14(22)11-15(16)21(26,20(23)25)12-17(24)13-5-8-18(27-2)19(10-13)28-3/h1,5-8,10-11,26H,9,12H2,2-3H3
Standard InChI Key: HJGXHTYVRYKSMB-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
6.3399 -0.5941 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2.6974 -0.8491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1020 0.2309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5981 -2.6114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6517 -3.0201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0194 -1.5127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4119 0.8983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4119 -0.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1965 -0.1816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9270 0.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1965 0.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7475 -1.1902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9110 -0.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9110 1.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2625 -1.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1570 1.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6255 -0.1816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6255 0.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4421 -1.7715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9571 -2.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1367 -2.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1065 -1.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3500 1.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8011 -1.5990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2860 -0.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5430 2.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1688 -2.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5043 -2.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 17 1 0
2 8 1 0
3 10 2 0
4 15 2 0
5 21 1 0
5 27 1 0
6 24 1 0
6 28 1 0
7 10 1 0
7 11 1 0
7 16 1 0
8 9 1 0
8 10 1 0
8 12 1 0
9 11 2 0
9 13 1 0
11 14 1 0
12 15 1 0
13 17 2 0
14 18 2 0
15 19 1 0
16 23 1 0
17 18 1 0
19 20 2 0
19 22 1 0
20 21 1 0
21 24 2 0
22 25 2 0
23 26 3 0
24 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.28Molecular Weight (Monoisotopic): 443.0368AlogP: 2.91#Rotatable Bonds: 6Polar Surface Area: 76.07Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.62CX Basic pKa: ┄CX LogP: 2.45CX LogD: 2.45Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.55Np Likeness Score: -0.74
References 1. PubChem BioAssay data set,