The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID47201072 ID: ALA1604752
PubChem CID: 23724218
Max Phase: Preclinical
Molecular Formula: C24H29N3O4
Molecular Weight: 423.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CNC(=O)CCC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1
Standard InChI: InChI=1S/C24H29N3O4/c1-31-23(30)18-25-21(28)12-13-22(29)26-14-16-27(17-15-26)24(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,24H,12-18H2,1H3,(H,25,28)
Standard InChI Key: QGSCZMXMLQXQRC-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
-0.5648 -2.6106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7082 -0.5481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.5661 -1.3731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8516 -2.6106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5786 -0.5481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1497 -1.3731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4227 -1.7856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2931 -0.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2931 0.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0076 -0.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5786 -1.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8641 -0.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8641 -1.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1497 -0.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5786 1.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7220 -0.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0076 1.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0076 -1.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5648 -1.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5786 1.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4365 -0.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0076 1.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7220 -1.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2793 -1.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2931 2.3394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4365 -1.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9937 -1.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7082 -1.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1371 -1.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8516 -1.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2806 -1.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 19 2 0
2 28 2 0
3 30 1 0
3 31 1 0
4 30 2 0
5 8 1 0
5 11 1 0
5 12 1 0
6 13 1 0
6 14 1 0
6 19 1 0
7 28 1 0
7 29 1 0
8 9 1 0
8 10 1 0
9 15 2 0
9 17 1 0
10 16 2 0
10 18 1 0
11 13 1 0
12 14 1 0
15 20 1 0
16 21 1 0
17 22 2 0
18 23 2 0
19 24 1 0
20 25 2 0
21 26 2 0
22 25 1 0
23 26 1 0
24 27 1 0
27 28 1 0
29 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.51Molecular Weight (Monoisotopic): 423.2158AlogP: 1.99#Rotatable Bonds: 8Polar Surface Area: 78.95Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.54CX Basic pKa: 7.30CX LogP: 1.64CX LogD: 1.39Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.11
References 1. PubChem BioAssay data set,