The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID7964776 ID: ALA1604776
PubChem CID: 5307222
Max Phase: Preclinical
Molecular Formula: C22H25N3O4
Molecular Weight: 395.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(C(=O)NCc3ccccn3)cn(CC(C)C)c(=O)c2cc1OC
Standard InChI: InChI=1S/C22H25N3O4/c1-14(2)12-25-13-18(21(26)24-11-15-7-5-6-8-23-15)16-9-19(28-3)20(29-4)10-17(16)22(25)27/h5-10,13-14H,11-12H2,1-4H3,(H,24,26)
Standard InChI Key: BFFXLPPVVYEMNT-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
-0.0252 3.5554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8327 1.0804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8327 2.7304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7396 -0.1571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7396 2.3179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6893 -0.1571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4038 -2.2196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6893 1.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6893 2.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0252 1.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0252 2.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4038 1.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7396 1.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4038 2.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1182 1.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1182 2.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0252 0.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4541 2.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1686 2.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6893 -0.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4038 -1.3946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5472 1.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5472 2.3179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1686 1.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8831 2.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1182 -0.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1182 -2.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8327 -1.3946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8327 -2.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 11 2 0
2 15 1 0
2 22 1 0
3 16 1 0
3 23 1 0
4 17 2 0
5 11 1 0
5 13 1 0
5 18 1 0
6 17 1 0
6 20 1 0
7 21 1 0
7 27 2 0
8 9 2 0
8 10 1 0
8 12 1 0
9 11 1 0
9 14 1 0
10 13 2 0
10 17 1 0
12 15 2 0
14 16 2 0
15 16 1 0
18 19 1 0
19 24 1 0
19 25 1 0
20 21 1 0
21 26 2 0
26 28 1 0
27 29 1 0
28 29 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 395.46Molecular Weight (Monoisotopic): 395.1845AlogP: 3.00#Rotatable Bonds: 7Polar Surface Area: 82.45Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.14CX LogP: 1.97CX LogD: 1.97Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.34
References 1. PubChem BioAssay data set,