The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24267303 ID: ALA1604810
PubChem CID: 4061656
Max Phase: Preclinical
Molecular Formula: C24H21FN2O3
Molecular Weight: 404.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC(=O)N2CC(=O)Nc3ccc(F)cc3C2c2ccccc2)cc1
Standard InChI: InChI=1S/C24H21FN2O3/c1-30-19-10-7-16(8-11-19)13-23(29)27-15-22(28)26-21-12-9-18(25)14-20(21)24(27)17-5-3-2-4-6-17/h2-12,14,24H,13,15H2,1H3,(H,26,28)
Standard InChI Key: AMSUTVUAUHLDCB-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-5.4841 2.4203 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.6784 1.0890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3770 4.6336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4963 -0.6001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8914 2.5020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6957 4.1722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6957 2.3184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3407 2.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3407 3.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8793 1.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3770 1.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5335 3.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0552 2.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8914 3.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0552 4.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7697 2.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2745 0.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6676 1.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7697 3.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5612 1.9800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0469 1.3350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4581 0.1487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8512 0.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2465 -0.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7689 1.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3483 0.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9819 0.0449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2833 0.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1661 -0.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3121 -0.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 16 1 0
2 11 2 0
3 14 2 0
4 27 1 0
4 30 1 0
5 7 1 0
5 11 1 0
5 12 1 0
6 9 1 0
6 14 1 0
7 8 1 0
7 10 1 0
8 9 2 0
8 13 1 0
9 15 1 0
10 17 2 0
10 18 1 0
11 20 1 0
12 14 1 0
13 16 2 0
15 19 2 0
16 19 1 0
17 22 1 0
18 23 2 0
20 21 1 0
21 25 2 0
21 26 1 0
22 24 2 0
23 24 1 0
25 28 1 0
26 29 2 0
27 28 2 0
27 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.44Molecular Weight (Monoisotopic): 404.1536AlogP: 3.95#Rotatable Bonds: 4Polar Surface Area: 58.64Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.17CX Basic pKa: ┄CX LogP: 3.68CX LogD: 3.68Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.72Np Likeness Score: -1.02
References 1. PubChem BioAssay data set,