The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID4257473 ID: ALA1604836
PubChem CID: 2937596
Max Phase: Preclinical
Molecular Formula: C22H28N2O5
Molecular Weight: 400.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc3ccccc3n2CC(O)CNC(CO)(CO)CO)cc1
Standard InChI: InChI=1S/C22H28N2O5/c1-29-19-8-6-16(7-9-19)21-10-17-4-2-3-5-20(17)24(21)12-18(28)11-23-22(13-25,14-26)15-27/h2-10,18,23,25-28H,11-15H2,1H3
Standard InChI Key: ABLQNMRKVYKQCQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
1.5549 -2.3932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4236 1.9953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0175 -1.1557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8260 -1.8701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6490 -0.4412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9838 -1.5682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1259 -1.5682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7375 -1.2326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0701 -2.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8770 -2.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2895 -1.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9090 -0.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2693 -1.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5180 -3.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1320 -3.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5549 -1.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2959 0.1264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6936 -0.1707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7730 -3.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5799 -3.9579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5885 -1.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8404 -1.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2521 1.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4675 0.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8652 0.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3030 -0.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0010 -1.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1760 -0.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2082 2.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 16 1 0
2 23 1 0
2 29 1 0
3 26 1 0
4 27 1 0
5 28 1 0
6 8 1 0
6 9 1 0
6 13 1 0
7 21 1 0
7 22 1 0
8 11 2 0
8 12 1 0
9 10 1 0
9 14 2 0
10 11 1 0
10 15 2 0
12 17 2 0
12 18 1 0
13 16 1 0
14 19 1 0
15 20 1 0
16 22 1 0
17 24 1 0
18 25 2 0
19 20 2 0
21 26 1 0
21 27 1 0
21 28 1 0
23 24 2 0
23 25 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.48Molecular Weight (Monoisotopic): 400.1998AlogP: 0.98#Rotatable Bonds: 10Polar Surface Area: 107.11Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.97CX Basic pKa: 8.34CX LogP: 0.62CX LogD: -0.37Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.35Np Likeness Score: -0.45
References 1. PubChem BioAssay data set,