The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID85199298 ID: ALA1604857
PubChem CID: 4848179
Max Phase: Preclinical
Molecular Formula: C20H21N3O7S
Molecular Weight: 447.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(N)(=O)=O)cc1C(=O)OCC(=O)N1c2ccccc2NC(=O)C1(C)C
Standard InChI: InChI=1S/C20H21N3O7S/c1-20(2)19(26)22-14-6-4-5-7-15(14)23(20)17(24)11-30-18(25)13-10-12(31(21,27)28)8-9-16(13)29-3/h4-10H,11H2,1-3H3,(H,22,26)(H2,21,27,28)
Standard InChI Key: RIPBYLDKIUPARM-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
3.9267 2.2498 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.3544 2.6623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5035 0.1873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0745 3.4873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0689 3.8998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0689 1.4248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6412 1.8373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3392 2.9642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7890 2.2498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2180 1.4248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5142 1.5353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7890 1.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5035 2.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5035 1.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2180 2.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0745 2.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5035 3.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7833 2.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9645 1.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3518 0.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9324 2.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2123 2.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3601 2.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7833 3.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0689 2.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4978 2.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2180 3.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2123 3.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9324 3.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4978 3.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0689 4.7248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 7 2 0
1 8 2 0
1 11 1 0
1 22 1 0
2 23 1 0
2 25 1 0
3 14 2 0
4 16 2 0
5 24 1 0
5 31 1 0
6 25 2 0
9 12 1 0
9 13 1 0
9 16 1 0
10 14 1 0
10 15 1 0
12 14 1 0
12 19 1 0
12 20 1 0
13 15 1 0
13 17 2 0
15 21 2 0
16 23 1 0
17 27 1 0
18 24 1 0
18 25 1 0
18 26 2 0
21 29 1 0
22 26 1 0
22 28 2 0
24 30 2 0
27 29 2 0
28 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.47Molecular Weight (Monoisotopic): 447.1100AlogP: 1.26#Rotatable Bonds: 5Polar Surface Area: 145.10Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.16CX Basic pKa: ┄CX LogP: 1.14CX LogD: 1.14Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.11
References 1. PubChem BioAssay data set,