The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID26754043 ID: ALA1604877
PubChem CID: 11949130
Max Phase: Preclinical
Molecular Formula: C23H27NO6
Molecular Weight: 413.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@@H]1C[C@@]2(O)[C@@H](O)[C@@H](O)[C@@H](O)C[C@H]2N1Cc1ccc(-c2ccccc2)cc1
Standard InChI: InChI=1S/C23H27NO6/c1-30-22(28)17-12-23(29)19(11-18(25)20(26)21(23)27)24(17)13-14-7-9-16(10-8-14)15-5-3-2-4-6-15/h2-10,17-21,25-27,29H,11-13H2,1H3/t17-,18-,19+,20-,21-,23-/m0/s1
Standard InChI Key: NPCBDFXWSDRHET-SABDPVTBSA-N
Molfile:
RDKit 2D
31 34 0 0 1 0 0 0 0 0999 V2000
4.9834 -1.9218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7841 -1.5048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2131 -2.3298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2131 -3.9798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5626 -3.8693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5626 -2.4403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2850 -3.8222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0697 -3.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0697 -2.7423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8001 -3.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7841 -2.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2850 -2.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7841 -3.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4986 -2.7423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4986 -3.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0301 -4.6069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9751 -3.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5821 -5.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3891 -5.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3272 -6.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6862 -6.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9411 -5.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8792 -6.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7376 -3.8693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2382 -7.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0452 -6.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9833 -7.8439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5972 -7.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5353 -8.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3423 -8.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9834 -4.3878 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9 1 1 6
11 2 1 1
14 3 1 1
15 4 1 1
5 17 1 0
5 24 1 0
6 17 2 0
7 8 1 0
7 10 1 0
7 16 1 0
8 9 1 0
8 13 1 0
8 31 1 6
9 11 1 0
9 12 1 0
10 12 1 0
10 17 1 6
11 14 1 0
13 15 1 0
14 15 1 0
16 18 1 0
18 19 2 0
18 20 1 0
19 22 1 0
20 23 2 0
21 22 2 0
21 23 1 0
21 25 1 0
25 26 2 0
25 27 1 0
26 28 1 0
27 29 2 0
28 30 2 0
29 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.47Molecular Weight (Monoisotopic): 413.1838AlogP: 0.69#Rotatable Bonds: 4Polar Surface Area: 110.46Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.57CX Basic pKa: 6.37CX LogP: 0.64CX LogD: 0.60Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.55Np Likeness Score: 0.66
References 1. PubChem BioAssay data set, 2. PubChem BioAssay data set,