The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID57258967 ID: ALA1604898
PubChem CID: 90660573
Max Phase: Preclinical
Molecular Formula: C23H25BrF3N3O5
Molecular Weight: 446.35
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(C(=O)N2CCC(N3CCCC3)CC2)cc1)c1ccc(Br)o1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C21H24BrN3O3.C2HF3O2/c22-19-8-7-18(28-19)20(26)23-16-5-3-15(4-6-16)21(27)25-13-9-17(10-14-25)24-11-1-2-12-24;3-2(4,5)1(6)7/h3-8,17H,1-2,9-14H2,(H,23,26);(H,6,7)
Standard InChI Key: RQUJLMPESBWQHA-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
6.3080 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4830 0.8250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4830 -0.8250 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.2455 -0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2455 0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4830 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6580 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1980 5.4764 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-0.5305 4.1664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1241 -0.6228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5199 2.8006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9680 -1.4627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0386 -3.7238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6361 1.9607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3036 -0.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8187 -0.0416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2969 -2.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1512 1.2933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7855 3.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3005 2.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4530 -2.1302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1475 -1.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0018 -0.1279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1542 0.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1174 -2.8839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1880 -2.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4867 0.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6693 1.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1980 4.6514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6105 3.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8654 4.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3739 -4.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8456 -3.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1782 -5.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9319 -4.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 6 1 0
2 6 1 0
3 6 1 0
4 7 2 0
5 7 1 0
6 7 1 0
8 29 1 0
9 19 1 0
9 29 1 0
10 15 2 0
11 20 2 0
12 15 1 0
12 21 1 0
12 22 1 0
13 17 1 0
13 32 1 0
13 33 1 0
14 18 1 0
14 20 1 0
15 16 1 0
16 23 2 0
16 24 1 0
17 25 1 0
17 26 1 0
18 27 2 0
18 28 1 0
19 20 1 0
19 30 2 0
21 25 1 0
22 26 1 0
23 27 1 0
24 28 2 0
29 31 2 0
30 31 1 0
32 34 1 0
33 35 1 0
34 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.35Molecular Weight (Monoisotopic): 445.1001AlogP: 3.99#Rotatable Bonds: 4Polar Surface Area: 65.79Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.30CX Basic pKa: 9.74CX LogP: 2.33CX LogD: 0.02Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.77Np Likeness Score: -1.85
References 1. PubChem BioAssay data set,