The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID49727795 ID: ALA1604917
Cas Number: 380592-09-6
PubChem CID: 3146522
Max Phase: Preclinical
Molecular Formula: C24H28N2O5
Molecular Weight: 424.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1ccc(C2C(C(=O)c3ccco3)=C(O)C(=O)N2CCN2CCOCC2)cc1
Standard InChI: InChI=1S/C24H28N2O5/c1-16(2)17-5-7-18(8-6-17)21-20(22(27)19-4-3-13-31-19)23(28)24(29)26(21)10-9-25-11-14-30-15-12-25/h3-8,13,16,21,28H,9-12,14-15H2,1-2H3
Standard InChI Key: JTOWMCKMEVFSMI-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-2.5522 3.0498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7965 3.4229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4543 1.6773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4072 -0.0452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0472 2.2773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7196 1.9548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4063 2.4498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2716 1.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0253 1.6773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9391 2.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1321 2.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7398 1.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1001 0.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7398 0.4398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1009 1.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3155 0.2798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7132 -0.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0723 -0.0452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5858 2.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7571 -1.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1440 -0.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5417 -0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1523 -0.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3273 -0.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5855 -1.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7418 1.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8912 3.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5623 1.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7117 3.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1991 -2.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1986 -2.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 10 1 0
2 11 2 0
3 12 2 0
4 14 1 0
4 23 1 0
5 28 1 0
5 29 1 0
6 8 1 0
6 11 1 0
6 15 1 0
7 19 1 0
7 26 1 0
7 27 1 0
8 9 1 0
8 13 1 0
9 10 2 0
9 12 1 0
10 11 1 0
12 14 1 0
13 16 2 0
13 17 1 0
14 18 2 0
15 19 1 0
16 21 1 0
17 22 2 0
18 24 1 0
20 21 2 0
20 22 1 0
20 25 1 0
23 24 2 0
25 30 1 0
25 31 1 0
26 28 1 0
27 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.50Molecular Weight (Monoisotopic): 424.1998AlogP: 3.31#Rotatable Bonds: 7Polar Surface Area: 83.22Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.62CX Basic pKa: 5.50CX LogP: 2.36CX LogD: 2.35Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.69Np Likeness Score: -1.45
References 1. PubChem BioAssay data set,