The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24387853 ID: ALA1604918
PubChem CID: 16011276
Max Phase: Preclinical
Molecular Formula: C27H27N3O5S
Molecular Weight: 505.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(OCc2nc(-c3ccc(C(=O)NCCc4ccc(S(N)(=O)=O)cc4)cc3)oc2C)cc1
Standard InChI: InChI=1S/C27H27N3O5S/c1-18-3-11-23(12-4-18)34-17-25-19(2)35-27(30-25)22-9-7-21(8-10-22)26(31)29-16-15-20-5-13-24(14-6-20)36(28,32)33/h3-14H,15-17H2,1-2H3,(H,29,31)(H2,28,32,33)
Standard InChI Key: RHIKHJMXGFQJFW-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
6.5835 -7.6661 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1453 0.6329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4127 0.3358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0685 -8.3335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2510 -7.1811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6505 -2.7353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0653 -0.1518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4945 -3.5752 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9161 -8.1510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8903 -0.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3753 -0.8192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8104 0.6329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4778 1.1178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3451 -2.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1957 -0.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0397 -1.5729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0258 0.8878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6807 -1.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5246 -2.2403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0986 -6.9986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8300 -2.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4778 1.9428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1288 -5.6637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2781 -7.0849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4342 -6.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3719 0.5907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7932 -6.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9492 -5.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6438 -4.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9794 -4.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9850 0.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5435 1.3977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9412 1.1006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7696 0.2936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3281 1.6526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7258 1.3555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 4 2 0
1 5 2 0
1 9 1 0
1 20 1 0
2 10 1 0
2 13 1 0
3 17 1 0
3 26 1 0
6 21 2 0
7 10 2 0
7 12 1 0
8 21 1 0
8 30 1 0
10 11 1 0
11 15 2 0
11 16 1 0
12 13 2 0
12 17 1 0
13 22 1 0
14 18 2 0
14 19 1 0
14 21 1 0
15 18 1 0
16 19 2 0
20 24 2 0
20 25 1 0
23 27 2 0
23 28 1 0
23 29 1 0
24 27 1 0
25 28 2 0
26 31 2 0
26 32 1 0
29 30 1 0
31 34 1 0
32 35 2 0
33 34 2 0
33 35 1 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.60Molecular Weight (Monoisotopic): 505.1671AlogP: 4.16#Rotatable Bonds: 9Polar Surface Area: 124.52Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.22CX Basic pKa: 0.26CX LogP: 3.99CX LogD: 3.99Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -1.50
References 1. PubChem BioAssay data set,