The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID7972533 ID: ALA1604981
PubChem CID: 2832588
Max Phase: Preclinical
Molecular Formula: C22H22F3N3O2
Molecular Weight: 417.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(N2C(=O)CC(N3CCN(c4cccc(C(F)(F)F)c4)CC3)C2=O)c1
Standard InChI: InChI=1S/C22H22F3N3O2/c1-15-4-2-7-18(12-15)28-20(29)14-19(21(28)30)27-10-8-26(9-11-27)17-6-3-5-16(13-17)22(23,24)25/h2-7,12-13,19H,8-11,14H2,1H3
Standard InChI Key: IMZFILKRCAUDQM-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
1.8103 -5.6432 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.9036 -4.9090 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.0761 -6.5499 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.0362 -1.5252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9403 -1.5252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4882 -1.2952 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5908 -3.2322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6209 -4.5670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0757 -2.5647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8208 -1.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1557 -1.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9007 -2.5647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4882 -0.4702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1360 -5.2345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7703 -3.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9264 -3.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2854 -3.8134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4414 -4.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2027 -0.0577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1694 -5.8157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7737 -0.0577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3155 -5.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9899 -5.7295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2027 0.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4716 -5.9882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1662 -6.5694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7737 0.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9867 -6.6556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4882 1.1798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9172 1.1798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 23 1 0
2 23 1 0
3 23 1 0
4 10 2 0
5 11 2 0
6 10 1 0
6 11 1 0
6 13 1 0
7 9 1 0
7 15 1 0
7 16 1 0
8 14 1 0
8 17 1 0
8 18 1 0
9 10 1 0
9 12 1 0
11 12 1 0
13 19 2 0
13 21 1 0
14 22 1 0
14 25 2 0
15 17 1 0
16 18 1 0
19 24 1 0
20 22 2 0
20 23 1 0
20 26 1 0
21 27 2 0
24 29 2 0
24 30 1 0
25 28 1 0
26 28 2 0
27 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.43Molecular Weight (Monoisotopic): 417.1664AlogP: 3.47#Rotatable Bonds: 3Polar Surface Area: 43.86Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.79CX Basic pKa: 6.19CX LogP: 4.01CX LogD: 3.99Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.72Np Likeness Score: -1.52
References 1. PubChem BioAssay data set, 2. PubChem BioAssay data set, 3. Salo HS, Laitinen T, Poso A, Jarho E, Lahtela-Kakkonen M.. (2013) Identification of novel SIRT3 inhibitor scaffolds by virtual screening., 23 (10): [PMID:23562596 ] [10.1016/j.bmcl.2013.03.033 ]