The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 4-[3-[4-ethyloxycarbonylanilino(thioxo)methylamino]anilino(thioxo)methylamino]benzoate ID: ALA160814
PubChem CID: 44373056
Max Phase: Preclinical
Molecular Formula: C26H26N4O4S2
Molecular Weight: 522.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(/N=C(\S)Nc2cccc(/N=C(/S)Nc3ccc(C(=O)OCC)cc3)c2)cc1
Standard InChI: InChI=1S/C26H26N4O4S2/c1-3-33-23(31)17-8-12-19(13-9-17)27-25(35)29-21-6-5-7-22(16-21)30-26(36)28-20-14-10-18(11-15-20)24(32)34-4-2/h5-16H,3-4H2,1-2H3,(H2,27,29,35)(H2,28,30,36)
Standard InChI Key: PNODIOWTIDAGND-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
3.3042 -0.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -3.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8667 0.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3125 -1.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -1.0375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0292 -3.5167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4542 -3.5125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -1.0292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -2.2750 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 0.2000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.6000 -2.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1542 0.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3125 -2.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3125 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -1.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8667 1.4458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3042 -1.0292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1625 -0.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8792 -1.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4375 0.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6000 -3.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1667 -3.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -0.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0292 -2.2667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5875 0.2125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1667 -2.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4500 -1.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7292 0.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8875 -3.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -3.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -3.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -2.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3000 0.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7417 -1.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0167 0.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7375 -1.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 12 1 0
4 11 1 0
5 1 2 0
6 14 1 0
7 2 2 0
8 1 1 0
9 2 1 0
10 1 1 0
11 21 2 0
12 20 2 0
13 15 2 0
14 13 1 0
15 5 1 0
16 3 2 0
17 4 2 0
18 27 2 0
19 26 2 0
20 28 1 0
21 29 1 0
22 7 1 0
23 8 1 0
24 4 1 0
25 3 1 0
26 22 1 0
27 23 1 0
28 23 2 0
29 22 2 0
30 32 2 0
31 30 1 0
32 15 1 0
33 25 1 0
34 24 1 0
35 33 1 0
36 34 1 0
12 18 1 0
14 31 2 0
11 19 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.65Molecular Weight (Monoisotopic): 522.1395AlogP: 6.10#Rotatable Bonds: 8Polar Surface Area: 101.38Molecular Species: ZWITTERIONHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: -0.55CX Basic pKa: 13.77CX LogP: 8.77CX LogD: 8.11Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.12Np Likeness Score: -0.89
References 1. Phuong T, Khac-Minh T, Van Ha NT, Ngoc Phuong HT.. (2004) Synthesis and antifungal activities of phenylenedithioureas., 14 (3): [PMID:14741262 ] [10.1016/j.bmcl.2003.11.044 ]