The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID3712085 ID: ALA1610180
Cas Number: 726144-25-8
PubChem CID: 2997882
Max Phase: Preclinical
Molecular Formula: C25H29N3O5
Molecular Weight: 451.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)COc1cccc2cccnc12
Standard InChI: InChI=1S/C25H29N3O5/c1-3-31-22-16-20(28-11-13-30-14-12-28)23(32-4-2)15-19(22)27-24(29)17-33-21-9-5-7-18-8-6-10-26-25(18)21/h5-10,15-16H,3-4,11-14,17H2,1-2H3,(H,27,29)
Standard InChI Key: VZELEVCSLRBHEE-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
0.8756 5.6641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9823 4.0141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9823 1.5391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5534 8.1391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9823 3.1891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5534 6.4891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5534 3.1891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4113 0.7141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5534 5.6641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1611 5.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5534 4.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2678 4.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2678 5.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1611 4.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6968 0.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9823 0.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6968 -0.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2678 2.7766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1611 6.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2678 6.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2678 1.9516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2678 0.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9823 -0.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4113 -0.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1611 7.7266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2678 7.7266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2678 -0.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8756 6.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6968 4.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1257 0.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1257 -0.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5900 6.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6968 5.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 10 1 0
1 28 1 0
2 12 1 0
2 29 1 0
3 16 1 0
3 21 1 0
4 25 1 0
4 26 1 0
5 18 2 0
6 9 1 0
6 19 1 0
6 20 1 0
7 11 1 0
7 18 1 0
8 15 2 0
8 30 1 0
9 10 2 0
9 13 1 0
10 14 1 0
11 12 1 0
11 14 2 0
12 13 2 0
15 16 1 0
15 17 1 0
16 22 2 0
17 23 1 0
17 24 2 0
18 21 1 0
19 25 1 0
20 26 1 0
22 27 1 0
23 27 2 0
24 31 1 0
28 32 1 0
29 33 1 0
30 31 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.52Molecular Weight (Monoisotopic): 451.2107AlogP: 3.89#Rotatable Bonds: 9Polar Surface Area: 82.15Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.95CX Basic pKa: 2.85CX LogP: 3.17CX LogD: 3.17Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: -1.65
References 1. PubChem BioAssay data set, 2. PubChem BioAssay data set,