(Z)-6-[(1R,2S,5S)-2-Azepan-1-yl-5-(2'-hydroxymethyl-biphenyl-4-ylmethoxy)-cyclopentyloxy]-hex-4-enoic acid

ID: ALA161108

PubChem CID: 44374517

Max Phase: Preclinical

Molecular Formula: C31H41NO5

Molecular Weight: 507.67

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  O=C(O)CC/C=C\CO[C@H]1[C@@H](OCc2ccc(-c3ccccc3CO)cc2)CC[C@@H]1N1CCCCCC1

Standard InChI:  InChI=1S/C31H41NO5/c33-22-26-10-5-6-11-27(26)25-15-13-24(14-16-25)23-37-29-18-17-28(32-19-7-1-2-8-20-32)31(29)36-21-9-3-4-12-30(34)35/h3,5-6,9-11,13-16,28-29,31,33H,1-2,4,7-8,12,17-23H2,(H,34,35)/b9-3-/t28-,29-,31+/m0/s1

Standard InChI Key:  KCLYPNKWGQYJSE-LYFCCYKMSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  1  0  0  0  0  0999 V2000
    3.1042   -3.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9250   -2.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6917   -3.9917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4000   -3.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3542   -1.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1042   -2.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5375   -1.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8792   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6792   -1.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7792   -3.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5417   -3.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7542   -0.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1250   -0.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1375   -1.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0167   -2.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8792   -2.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7167   -2.3875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0792   -1.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9042   -1.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7792   -4.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3042   -0.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3167   -1.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4250   -4.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4625   -3.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7292    1.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3042   -2.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7625   -1.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3292    0.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3167   -2.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3792   -3.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5667   -0.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8625   -5.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1625   -4.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5792   -1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9792   -0.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2625   -4.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6792   -5.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  1
  4  1  1  0
  5  7  1  0
  6  2  1  0
  7 14  1  0
  8 29  1  0
  6  9  1  6
 10  4  1  0
 11  8  2  0
 12  5  1  0
 13 21  1  0
 14 22  2  0
 15 26  1  0
 16 15  2  0
  2 17  1  6
 18  9  1  0
 19 18  1  0
 20  8  1  0
 21 19  2  0
 22 19  1  0
 23  3  1  0
 24  3  1  0
 25 28  1  0
 26 17  1  0
 27  5  2  0
 28 12  1  0
 29 30  1  0
 30 16  1  0
 31 12  2  0
 32 23  1  0
 33 24  1  0
 34 27  1  0
 35 34  2  0
 36 33  1  0
 37 32  1  0
  6 10  1  0
 36 37  1  0
 13  7  2  0
 35 31  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA161108

   (Z)-6-[(1R,2S,5S)-2-(azepan-1-yl)-5-[[4-[2-(hydroxymethyl)phenyl]phenyl]methoxy]cyclopentyl]oxyhex-4-enoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 507.67

Molecular Weight (Monoisotopic): 507.2985

AlogP: 5.58

#Rotatable Bonds: 12

Polar Surface Area: 79.23

Molecular Species: ZWITTERION

HBA: 5

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 6

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 3.79

CX Basic pKa: 10.12

CX LogP: 2.54

CX LogD: 2.54

Aromatic Rings: 2

Heavy Atoms: 37

QED Weighted: 0.37

Np Likeness Score: 0.72

References

1. Campbell I, Collington E, Finch H, Hallett P, Hayes R, Lumley P, Mills K, Wallis C, White B.  (1991)  Synthesis and pharmacological evaluation of novel Amino-prostanoids: potent and orally effective thromboxane A2 receptor antagonists,  1  (12): [10.1016/S0960-894X(01)81049-0]

Source

Source(1):

• Scientific Literature