The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24393936 ID: ALA1612646
PubChem CID: 3303782
Max Phase: Preclinical
Molecular Formula: C27H27N3O
Molecular Weight: 409.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C)c(Cn2c(C3CC(=O)N(c4ccccc4C)C3)nc3ccccc32)c1
Standard InChI: InChI=1S/C27H27N3O/c1-18-12-13-19(2)21(14-18)16-30-25-11-7-5-9-23(25)28-27(30)22-15-26(31)29(17-22)24-10-6-4-8-20(24)3/h4-14,22H,15-17H2,1-3H3
Standard InChI Key: GANAYFSRMHCTMD-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
-2.6913 0.2694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5556 0.4994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5556 1.8342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0238 1.5793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0707 1.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7543 1.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3402 0.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3402 1.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2392 1.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0238 0.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2392 0.4994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3007 -0.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6913 2.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0547 0.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8527 -0.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0547 1.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4450 1.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7692 0.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5978 -1.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7692 1.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6050 2.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6597 -0.7268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1124 2.2136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2117 -1.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1498 -2.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2725 3.3696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9568 -2.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0262 3.0341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5312 0.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2092 -1.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0187 -1.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 10 2 0
2 5 1 0
2 7 1 0
2 12 1 0
3 5 2 0
3 8 1 0
4 9 1 0
4 10 1 0
4 13 1 0
5 6 1 0
6 9 1 0
6 11 1 0
7 8 2 0
7 14 1 0
8 16 1 0
10 11 1 0
12 15 1 0
13 17 2 0
13 21 1 0
14 18 2 0
15 19 2 0
15 22 1 0
16 20 2 0
17 23 1 0
17 29 1 0
18 20 1 0
19 25 1 0
19 30 1 0
21 26 2 0
22 24 2 0
23 28 2 0
24 27 1 0
24 31 1 0
25 27 2 0
26 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 409.53Molecular Weight (Monoisotopic): 409.2154AlogP: 5.53#Rotatable Bonds: 4Polar Surface Area: 38.13Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.79CX LogP: 5.78CX LogD: 5.77Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -1.57
References 1. PubChem BioAssay data set,