(Z)-6-[(1R,2S)-2-Azepan-1-yl-5-(4'-methylsulfamoylmethyl-biphenyl-4-ylmethoxy)-cyclopentyloxy]-hex-4-enoic acid

ID: ALA161360

PubChem CID: 44374480

Max Phase: Preclinical

Molecular Formula: C32H44N2O6S

Molecular Weight: 584.78

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CNS(=O)(=O)Cc1ccc(-c2ccc(COC3CC[C@H](N4CCCCCC4)[C@H]3OC/C=C\CCC(=O)O)cc2)cc1

Standard InChI:  InChI=1S/C32H44N2O6S/c1-33-41(37,38)24-26-12-16-28(17-13-26)27-14-10-25(11-15-27)23-40-30-19-18-29(34-20-6-2-3-7-21-34)32(30)39-22-8-4-5-9-31(35)36/h4,8,10-17,29-30,32-33H,2-3,5-7,9,18-24H2,1H3,(H,35,36)/b8-4-/t29-,30?,32+/m0/s1

Standard InChI Key:  IMUPQXOQMCAJLF-KONHRLNYSA-N

Molfile:  

     RDKit          2D

 41 44  0  0  1  0  0  0  0  0999 V2000
    5.8417   -1.3875    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.7417   -4.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5542   -3.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3250   -5.1125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0292   -4.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4250   -0.6750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4375   -1.9625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2625   -3.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5125   -4.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4417   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6667   -1.3750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9875   -2.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1667   -2.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6875   -2.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5875   -4.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1750   -4.2417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3917   -2.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3875   -1.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7542   -1.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7667   -2.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6500   -3.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5125   -3.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3500   -3.5042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6167   -2.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2833   -2.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5417   -2.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4167   -5.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2167   -2.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2000   -1.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9542   -2.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9417   -1.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0542   -5.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0917   -4.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0250   -4.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9500   -4.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0125   -4.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0917   -2.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7917   -5.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4917   -6.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8917   -6.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3167   -6.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  8  1  0
  2  4  1  1
  5 15  1  0
  6  1  2  0
  7  1  2  0
  8 14  1  0
  9 35  1  0
 10  1  1  0
 11  1  1  0
 12 18  1  0
 13 12  1  0
 14 25  1  0
 15  8  1  0
 16  9  2  0
 17 28  1  0
 18 29  2  0
 19 13  2  0
 20 13  1  0
 21 34  1  0
 22 21  2  0
  3 23  1  6
 24 10  1  0
 25 26  1  0
 26 30  1  0
 27  9  1  0
 28 24  2  0
 29 24  1  0
 30 20  2  0
 31 19  1  0
 32  4  1  0
 33  4  1  0
 34 23  1  0
 35 36  1  0
 36 22  1  0
 37 11  1  0
 38 33  1  0
 39 32  1  0
 40 38  1  0
 41 39  1  0
 12 17  2  0
 31 26  2  0
  5  2  1  0
 40 41  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA161360

   (Z)-6-[(1R,2S)-2-(azepan-1-yl)-5-[[4-[4-(methylsulfamoylmethyl)phenyl]phenyl]methoxy]cyclopentyl]oxyhex-4-enoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 584.78

Molecular Weight (Monoisotopic): 584.2920

AlogP: 5.13

#Rotatable Bonds: 14

Polar Surface Area: 105.17

Molecular Species: ZWITTERION

HBA: 6

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 8

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 3.79

CX Basic pKa: 10.09

CX LogP: 1.90

CX LogD: 1.89

Aromatic Rings: 2

Heavy Atoms: 41

QED Weighted: 0.30

Np Likeness Score: 0.15

References

1. Campbell I, Collington E, Finch H, Hallett P, Hayes R, Lumley P, Mills K, Wallis C, White B.  (1991)  Synthesis and pharmacological evaluation of novel Amino-prostanoids: potent and orally effective thromboxane A2 receptor antagonists,  1  (12): [10.1016/S0960-894X(01)81049-0]

Source

Source(1):

• Scientific Literature