1-Methyl-4-[4-(3-trifluoromethyl-phenyl)-but-3-enyl]-piperazine

ID: ALA161545

PubChem CID: 12730768

Max Phase: Preclinical

Molecular Formula: C16H21F3N2

Molecular Weight: 298.35

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN(CC/C=C\c2cccc(C(F)(F)F)c2)CC1

Standard InChI:  InChI=1S/C16H21F3N2/c1-20-9-11-21(12-10-20)8-3-2-5-14-6-4-7-15(13-14)16(17,18)19/h2,4-7,13H,3,8-12H2,1H3/b5-2-

Standard InChI Key:  RMEPJCDUESJVLY-DJWKRKHSSA-N

Molfile:  

     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
   -4.6625   -3.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3708   -4.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7750   -6.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9750   -6.1917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7708   -4.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9333   -3.1042    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4333   -2.9917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2833   -3.4667    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8750   -4.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5833   -5.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0833   -6.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0708   -5.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6750   -6.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6708   -5.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4750   -4.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5750   -6.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1750   -6.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6708   -4.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3750   -5.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8750   -5.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7833   -5.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3 12  1  0
  4 16  1  0
  5  2  1  0
  6  1  1  0
  7  1  1  0
  8  1  1  0
  9 15  1  0
 10  9  2  0
 11 13  1  0
 12 14  1  0
 13  4  1  0
 14  4  1  0
 15  5  2  0
 16 20  1  0
 17  3  1  0
 18  2  2  0
 19 18  1  0
 20 10  1  0
 21 19  2  0
 15 21  1  0
  3 11  1  0
M  END

Associated Targets(Human)

DRD2 Tclin Dopamine receptor (115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 298.35Molecular Weight (Monoisotopic): 298.1657AlogP: 3.36#Rotatable Bonds: 4
Polar Surface Area: 6.48Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.42CX LogP: 3.54CX LogD: 2.48
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.84Np Likeness Score: -0.81

References

1. Glennon RA, Salley JJ, Steinsland OS, Nelson S..  (1981)  Synthesis and evaluation of novel alkylpiperazines as potential dopamine antagonists.,  24  (6): [PMID:7252977] [10.1021/jm00138a007]

Source