The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,4S,5R)-5-{[(1S)-1-carboxylato-2,2,2-trifluoro-1-(phosphonatooxy)ethyl]oxy}-4-hydroxy-3-[(hydroxyphosphinato)oxy]cyclohex-1-ene-1-carboxylate; Sodium ID: ALA1627010
PubChem CID: 53326392
Max Phase: Preclinical
Molecular Formula: C10H12F3NaO14P2
Molecular Weight: 476.14
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C([O-])C1=C[C@@H](OP(=O)(O)O)[C@@H](O)[C@H](O[C@](OP(=O)(O)O)(C(=O)O)C(F)(F)F)C1.[Na+]
Standard InChI: InChI=1S/C10H13F3O14P2.Na/c11-10(12,13)9(8(17)18,27-29(22,23)24)25-4-1-3(7(15)16)2-5(6(4)14)26-28(19,20)21;/h2,4-6,14H,1H2,(H,15,16)(H,17,18)(H2,19,20,21)(H2,22,23,24);/q;+1/p-1/t4-,5-,6+,9+;/m1./s1
Standard InChI Key: COJXFWPMJUITPC-YWJASCBZSA-M
Molfile:
RDKit 2D
30 29 0 0 0 0 0 0 0 0999 V2000
-1.0750 -3.7417 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
5.6417 -3.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6542 -2.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6417 -4.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3667 -2.3542 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
2.7917 -3.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9292 -4.0042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5042 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0542 -4.0042 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
4.2167 -3.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7917 -2.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3667 -4.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5042 -3.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5042 -1.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0792 -4.0042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2167 -2.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7917 -3.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0417 -3.1417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7917 -1.1042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0792 -3.5917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2167 -1.1042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9167 -4.8167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.6417 -5.2417 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.2292 -5.1292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.9417 -1.6292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0792 -1.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 -4.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0417 -4.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5042 -4.8167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3542 -4.8292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 1
4 2 1 0
5 3 1 0
6 13 1 0
7 2 1 0
8 16 1 0
9 15 1 0
10 7 1 1
11 8 2 0
2 12 1 6
13 10 1 0
14 8 1 0
6 15 1 6
16 10 1 0
17 5 2 0
18 9 2 0
19 14 1 0
20 12 2 0
21 14 2 0
22 4 1 0
23 4 1 0
24 4 1 0
25 5 1 0
26 5 1 0
27 9 1 0
28 9 1 0
13 29 1 6
30 12 1 0
6 11 1 0
M CHG 2 1 1 19 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.14Molecular Weight (Monoisotopic): 475.9733AlogP: -0.92#Rotatable Bonds: 8Polar Surface Area: 237.58Molecular Species: ACIDHBA: 8HBD: 7#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: -0.42CX Basic pKa: ┄CX LogP: -0.64CX LogD: -15.04Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.17Np Likeness Score: 1.00
References 1. Peterson ML, Corey SD, Font JL, Walker MC, Sikorski JA. (1996) New simplified inhibitors of EPSP synthase: The importance of ring size for recognition at the shikimate 3-phosphate site, 6 (23): [10.1016/S0960-894X(96)00527-6 ]