The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,4S,5R)-5-{[(1S)-1-(fluoromethyl)-2-oxido-2-oxo-1-(phosphonatooxy)ethyl]oxy}-4-hydroxy-3-[(hydroxyphosphinato)oxy]cyclohex-1-ene-1-carboxylate; Sodium ID: ALA1627014
PubChem CID: 53317223
Max Phase: Preclinical
Molecular Formula: C10H14FNaO14P2
Molecular Weight: 440.16
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C([O-])C1=C[C@@H](OP(=O)(O)O)[C@@H](O)[C@H](O[C@](CF)(OP(=O)(O)O)C(=O)O)C1.[Na+]
Standard InChI: InChI=1S/C10H15FO14P2.Na/c11-3-10(9(15)16,25-27(20,21)22)23-5-1-4(8(13)14)2-6(7(5)12)24-26(17,18)19;/h2,5-7,12H,1,3H2,(H,13,14)(H,15,16)(H2,17,18,19)(H2,20,21,22);/q;+1/p-1/t5-,6-,7+,10-;/m1./s1
Standard InChI Key: OEQXOWGCWNPOLH-NDGFODGGSA-M
Molfile:
RDKit 2D
28 27 0 0 0 0 0 0 0 0999 V2000
-1.2625 -3.4917 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
5.5792 -3.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5792 -3.0167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2917 -2.6042 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -3.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -2.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9792 -4.2542 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
2.7292 -3.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1417 -3.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8667 -4.2542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -4.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2917 -4.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -1.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0042 -4.2542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1417 -3.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7167 -3.3042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9792 -3.3917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7167 -1.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0042 -3.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1542 -1.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0042 -2.1917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8792 -1.8917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5667 -4.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9792 -5.2417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1042 -4.2542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -5.0792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2917 -5.0792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8542 -5.0792 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 1
4 3 1 0
5 11 1 0
6 15 1 0
7 14 1 0
8 6 2 0
9 10 1 1
10 2 1 0
11 9 1 0
2 12 1 6
13 6 1 0
5 14 1 6
15 9 1 0
16 4 2 0
17 7 2 0
18 13 1 0
19 12 2 0
20 13 2 0
21 4 1 0
22 4 1 0
23 2 1 0
24 7 1 0
25 7 1 0
11 26 1 6
27 12 1 0
28 23 1 0
5 8 1 0
M CHG 2 1 1 18 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.16Molecular Weight (Monoisotopic): 439.9921AlogP: -1.52#Rotatable Bonds: 9Polar Surface Area: 237.58Molecular Species: ACIDHBA: 8HBD: 7#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 0.20CX Basic pKa: ┄CX LogP: -1.39CX LogD: -15.49Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.16Np Likeness Score: 1.17
References 1. Peterson ML, Corey SD, Font JL, Walker MC, Sikorski JA. (1996) New simplified inhibitors of EPSP synthase: The importance of ring size for recognition at the shikimate 3-phosphate site, 6 (23): [10.1016/S0960-894X(96)00527-6 ]