The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 4-[3-(5-{[(2S)-2-{[4-bromo-2,5-dichlorothiophene-3-(methane)sulfinyl]amino}-3-(tert-butoxy)-3-oxopropyl]carbamoyl}-6-(methylcarbamoyl)-2,3-dihydro-1H-isoindol-2-yl)-3-oxopropyl]piperidine-1-carboxylate ID: ALA1627240
PubChem CID: 52943159
Max Phase: Preclinical
Molecular Formula: C36H48BrCl2N5O8S2
Molecular Weight: 893.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=[S+]([O-])(N[C@@H](CNC(=O)c1cc2c(cc1C(=O)NC)CN(C(=O)CCC1CCN(C(=O)OC(C)(C)C)CC1)C2)C(=O)OC(C)(C)C)c1c(Cl)sc(Cl)c1Br
Standard InChI: InChI=1S/C36H48BrCl2N5O8S2/c1-35(2,3)51-33(48)25(42-54(8,50)28-27(37)29(38)53-30(28)39)17-41-32(47)24-16-22-19-44(18-21(22)15-23(24)31(46)40-7)26(45)10-9-20-11-13-43(14-12-20)34(49)52-36(4,5)6/h15-16,20,25,42H,8-14,17-19H2,1-7H3,(H2-,40,41,46,47,50)/t25-,54?/m0/s1
Standard InChI Key: GQMDCZCQUJAPEV-GWKYLOPHSA-N
Molfile:
RDKit 2D
54 57 0 0 0 0 0 0 0 0999 V2000
7.3901 -5.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1332 -5.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6943 -4.4237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5040 -4.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2020 -6.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7593 -5.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5151 -5.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4248 -6.5568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6134 -6.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0388 -7.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8628 -7.9253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8289 -6.8618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4768 -8.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3007 -9.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9188 -9.8468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7455 -10.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9563 -10.9114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3403 -10.3545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5133 -9.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7833 -11.7228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3994 -12.2783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9942 -11.9786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2265 -13.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8426 -13.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4374 -13.3454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2752 -13.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4412 -3.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6305 -3.4579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9988 -3.0195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3774 -2.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5667 -2.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3135 -1.7020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5028 -1.5262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8712 -1.0878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2497 -0.7362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4390 -0.5604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8073 -0.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8031 -0.0372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0091 -3.1063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1983 -2.9304 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.7613 -2.3161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5866 -2.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6938 -3.5890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9261 -4.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2427 -4.8530 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5842 -4.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8605 -3.5663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7890 -4.5848 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.7077 -4.6605 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.3906 -2.8825 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
6.3220 -4.8681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7658 -5.4836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0671 -4.0787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0206 -6.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
3 27 1 0
11 13 1 0
27 28 1 0
2 3 1 0
27 29 2 0
13 14 1 0
28 30 1 0
14 15 1 0
30 31 1 0
31 32 1 0
3 4 2 0
32 33 1 0
6 7 1 0
32 34 2 0
7 8 1 0
33 35 1 0
8 9 1 0
35 36 1 0
14 19 1 0
35 37 1 0
15 16 1 0
35 38 1 0
16 17 1 0
31 39 1 6
17 18 1 0
39 40 1 0
18 19 1 0
40 41 1 0
9 5 1 0
40 42 2 0
17 20 1 0
40 43 1 0
46 47 2 0
4 6 1 0
44 45 1 0
20 21 1 0
8 10 1 0
20 22 2 0
43 44 2 0
45 46 1 0
47 43 1 0
5 6 2 0
46 48 1 0
21 23 1 0
44 49 1 0
10 11 1 0
47 50 1 0
23 24 1 0
2 51 1 0
1 2 2 0
51 52 1 0
23 25 1 0
52 54 1 0
10 12 2 0
23 26 1 0
51 53 2 0
M CHG 2 40 1 41 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 893.75Molecular Weight (Monoisotopic): 891.1505AlogP: 6.17#Rotatable Bonds: 11Polar Surface Area: 169.44Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.31CX Basic pKa: ┄CX LogP: 4.55CX LogD: 4.50Aromatic Rings: 2Heavy Atoms: 54QED Weighted: 0.14Np Likeness Score: -0.74
References 1. Tan DS.. (2005) Diversity-oriented synthesis: exploring the intersections between chemistry and biology., 1 (2): [PMID:16408003 ] [10.1038/nchembio0705-74 ]