2,2-Dimethyl-N-(3-pyridin-2-yl-isoquinolin-1-yl)-propionamide

ID: ALA164156

PubChem CID: 14040414

Max Phase: Preclinical

Molecular Formula: C19H19N3O

Molecular Weight: 305.38

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)C(=O)Nc1nc(-c2ccccn2)cc2ccccc12

Standard InChI:  InChI=1S/C19H19N3O/c1-19(2,3)18(23)22-17-14-9-5-4-8-13(14)12-16(21-17)15-10-6-7-11-20-15/h4-12H,1-3H3,(H,21,22,23)

Standard InChI Key:  WZAHIXQNNGKREG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   -0.9583   -6.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1958   -5.6542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9583   -6.9875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1958   -7.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1958   -4.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7208   -5.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9625   -4.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7208   -4.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2000   -8.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5667   -4.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3292   -4.7667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5667   -6.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4875   -4.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9708   -8.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5625   -8.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0583   -8.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4875   -6.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0917   -4.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5542   -3.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2500   -4.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0875   -3.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2500   -5.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3167   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  3  1  0
  5  2  1  0
  6  1  1  0
  7  8  1  0
  8  6  1  0
  9  4  1  0
 10  5  1  0
 11 10  2  0
 12  4  2  0
 13  8  2  0
 14  9  1  0
 15  9  1  0
 16  9  1  0
 17  6  2  0
 18 11  1  0
 19 10  1  0
 20 22  2  0
 21 23  1  0
 22 17  1  0
 23 19  2  0
  5  7  2  0
 13 20  1  0
 18 21  2  0
M  END

Associated Targets(non-human)

Mycoplasmoides gallisepticum (165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 305.38Molecular Weight (Monoisotopic): 305.1528AlogP: 4.28#Rotatable Bonds: 2
Polar Surface Area: 54.88Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.80CX Basic pKa: 3.04CX LogP: 4.58CX LogD: 4.58
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.77Np Likeness Score: -0.94

References

1. de Zwart MA, van der Goot H, Timmerman H..  (1988)  Synthesis and copper-dependent antimycoplasmal activity of 1-amino-3-(2-pyridyl)isoquinoline derivatives. 1. Amides.,  31  (4): [PMID:3351847] [10.1021/jm00399a005]

Source