The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(1,2-Phenylene)bis(3,4,5-trifluoro-N-methylbenzothioamide) ID: ALA1641768
PubChem CID: 53325425
Max Phase: Preclinical
Molecular Formula: C21H12F6N2S2
Molecular Weight: 470.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C(=S)c1cc(F)c(F)c(F)c1)c1ccccc1NC(=S)c1cc(F)c(F)c(F)c1
Standard InChI: InChI=1S/C21H12F6N2S2/c1-29(21(31)11-8-14(24)19(27)15(25)9-11)17-5-3-2-4-16(17)28-20(30)10-6-12(22)18(26)13(23)7-10/h2-9H,1H3,(H,28,30)
Standard InChI Key: SVJJHJMZZYNCFJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
-5.1669 -10.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1681 -10.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4552 -11.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7358 -10.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7390 -10.0240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4572 -9.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0211 -11.2668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0203 -12.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3054 -12.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7344 -12.5049 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.3074 -13.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5934 -13.7408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8783 -13.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8817 -12.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5963 -12.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0266 -9.6080 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0307 -8.7830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3183 -8.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7471 -8.3740 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.6047 -8.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8928 -8.3629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8965 -7.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6179 -7.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3269 -7.5461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6250 -6.3035 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.1846 -7.1202 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.1765 -8.7722 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.1692 -12.0827 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.1630 -13.7385 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.5931 -14.5657 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.3101 -10.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 9 1 0
3 4 2 0
5 16 1 0
7 8 1 0
16 17 1 0
17 18 1 0
8 9 1 0
17 19 2 0
4 5 1 0
18 20 2 0
8 10 2 0
20 21 1 0
2 3 1 0
21 22 2 0
9 11 2 0
22 23 1 0
5 6 2 0
23 24 2 0
24 18 1 0
11 12 1 0
23 25 1 0
6 1 1 0
22 26 1 0
12 13 2 0
21 27 1 0
1 2 2 0
14 28 1 0
13 14 1 0
13 29 1 0
4 7 1 0
12 30 1 0
14 15 2 0
16 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.46Molecular Weight (Monoisotopic): 470.0346AlogP: 6.12#Rotatable Bonds: 4Polar Surface Area: 15.27Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.80CX Basic pKa: ┄CX LogP: 6.66CX LogD: 6.66Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.28Np Likeness Score: -0.94
References 1. Brunhofer G, Granig WH, Studenik CR, Erker T.. (2011) A journey from benzanilides to dithiobenzanilides: Synthesis of selective spasmolytic compounds., 19 (2): [PMID:21185194 ] [10.1016/j.bmc.2010.11.043 ]