The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-((3-(3,5-dichlorophenyl)-5-(4-(trifluoromethoxy)phenyl)-1H-pyrazol-1-yl)methyl)benzamido)propanoic acid ID: ALA1644183
PubChem CID: 9985625
Max Phase: Preclinical
Molecular Formula: C27H20Cl2F3N3O4
Molecular Weight: 578.37
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CCNC(=O)c1ccc(Cn2nc(-c3cc(Cl)cc(Cl)c3)cc2-c2ccc(OC(F)(F)F)cc2)cc1
Standard InChI: InChI=1S/C27H20Cl2F3N3O4/c28-20-11-19(12-21(29)13-20)23-14-24(17-5-7-22(8-6-17)39-27(30,31)32)35(34-23)15-16-1-3-18(4-2-16)26(38)33-10-9-25(36)37/h1-8,11-14H,9-10,15H2,(H,33,38)(H,36,37)
Standard InChI Key: IGCXZPHCSPIQHB-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
-0.3331 -7.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7498 -8.5778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3431 -9.2918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4803 -9.2966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8952 -8.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4861 -7.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7202 -8.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1314 -9.2982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1340 -7.8693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9564 -9.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5748 -8.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9918 -9.2844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8133 -9.3620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9900 -10.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2781 -10.5849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6616 -10.0367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7426 -10.4991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4070 -10.0082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1622 -10.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2542 -11.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5849 -11.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8323 -11.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8597 -10.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6102 -11.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1949 -11.1776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7514 -10.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4971 -9.7780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3074 -9.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5576 -10.7424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8091 -11.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6153 -11.7032 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2544 -12.1388 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.0208 -12.3208 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.3676 -10.0149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8264 -9.8489 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.6734 -12.4689 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.1926 -10.0164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6065 -10.7331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6091 -9.3042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
19 20 2 0
8 10 1 0
20 21 1 0
2 3 1 0
21 22 2 0
22 17 1 0
14 17 1 0
2 11 1 0
5 6 2 0
23 24 2 0
11 12 1 0
24 25 1 0
12 13 1 0
25 26 2 0
6 1 1 0
26 27 1 0
1 2 2 0
27 28 2 0
28 23 1 0
16 23 1 0
5 7 1 0
26 29 1 0
3 4 2 0
29 30 1 0
13 14 2 0
30 31 1 0
14 15 1 0
30 32 1 0
15 16 2 0
30 33 1 0
16 12 1 0
10 34 1 0
7 8 1 0
19 35 1 0
21 36 1 0
17 18 2 0
34 37 1 0
7 9 2 0
18 19 1 0
37 38 1 0
37 39 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 578.37Molecular Weight (Monoisotopic): 577.0783AlogP: 6.68#Rotatable Bonds: 9Polar Surface Area: 93.45Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.94CX Basic pKa: 1.90CX LogP: 7.15CX LogD: 3.96Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.23Np Likeness Score: -1.36
References 1. Shen DM, Brady EJ, Candelore MR, Dallas-Yang Q, Ding VD, Feeney WP, Jiang G, McCann ME, Mock S, Qureshi SA, Saperstein R, Shen X, Tong X, Tota LM, Wright MJ, Yang X, Zheng S, Chapman KT, Zhang BB, Tata JR, Parmee ER.. (2011) Discovery of novel, potent, selective, and orally active human glucagon receptor antagonists containing a pyrazole core., 21 (1): [PMID:21147532 ] [10.1016/j.bmcl.2010.11.074 ] 2. Xiong Y, Guo J, Candelore MR, Liang R, Miller C, Dallas-Yang Q, Jiang G, McCann PE, Qureshi SA, Tong X, Xu SS, Shang J, Vincent SH, Tota LM, Wright MJ, Yang X, Zhang BB, Tata JR, Parmee ER.. (2012) Discovery of a novel glucagon receptor antagonist N-[(4-{(1S)-1-[3-(3, 5-dichlorophenyl)-5-(6-methoxynaphthalen-2-yl)-1H-pyrazol-1-yl]ethyl}phenyl)carbonyl]-β-alanine (MK-0893) for the treatment of type II diabetes., 55 (13): [PMID:22708876 ] [10.1021/jm300579z ]