4-(4,5-di(biphenyl-4-yl)-1H-imidazol-2-yl)benzoic acid

ID: ALA1649741

Cas Number: 312320-13-1

PubChem CID: 2259006

Max Phase: Preclinical

Molecular Formula: C34H24N2O2

Molecular Weight: 492.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)c(-c3ccc(-c4ccccc4)cc3)[nH]2)cc1

Standard InChI:  InChI=1S/C34H24N2O2/c37-34(38)30-21-19-29(20-22-30)33-35-31(27-15-11-25(12-16-27)23-7-3-1-4-8-23)32(36-33)28-17-13-26(14-18-28)24-9-5-2-6-10-24/h1-22H,(H,35,36)(H,37,38)

Standard InChI Key:  NAQOLNGSQBINHO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   -4.8454   -6.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4355   -7.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6100   -7.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1934   -6.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6084   -5.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4325   -5.9430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3726   -6.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9623   -7.3816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1381   -7.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7232   -6.6698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1385   -5.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9613   -5.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1018   -6.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5884   -7.3343    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3733   -7.0801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3741   -6.2550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5897   -5.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3351   -5.2147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8901   -4.6058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6362   -3.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1715   -3.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7247   -4.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4678   -5.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4260   -2.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1273   -2.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1277   -1.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9356   -1.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4880   -1.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2301   -2.6999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0892   -7.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0905   -8.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8055   -8.7230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5196   -8.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5142   -7.4788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7987   -7.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2360   -8.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2398   -9.5422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9485   -8.3015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  4  5  1  0
 18 19  2  0
  9 10  2  0
 19 20  1  0
  2  3  1  0
 20 21  2  0
 10 11  1  0
 21 22  1  0
  5  6  2  0
 22 23  2  0
 23 18  1  0
 11 12  2  0
 12  7  1  0
 24 25  2  0
  4  7  1  0
 25 26  1  0
  6  1  1  0
 26 27  2  0
 10 13  1  0
 27 28  1  0
 13 14  1  0
 28 29  2  0
 29 24  1  0
 21 24  1  0
  1  2  2  0
  3  4  2  0
 30 31  2  0
  7  8  2  0
 31 32  1  0
 32 33  2  0
 14 15  2  0
 33 34  1  0
 15 16  1  0
 34 35  2  0
 35 30  1  0
 15 30  1  0
 16 17  1  0
 33 36  1  0
 17 13  2  0
 36 37  2  0
  8  9  1  0
 36 38  1  0
M  END

Associated Targets(non-human)

resT Telomere resolvase resT (23 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.58Molecular Weight (Monoisotopic): 492.1838AlogP: 8.44#Rotatable Bonds: 6
Polar Surface Area: 65.98Molecular Species: ACIDHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.75CX Basic pKa: 4.99CX LogP: 7.26CX LogD: 5.26
Aromatic Rings: 6Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -0.43

References

1. Lefas G, Chaconas G..  (2009)  High-throughput screening identifies three inhibitor classes of the telomere resolvase from the lyme disease spirochete.,  53  (10): [PMID:19596868] [10.1128/aac.00529-09]
2. Hu X, Vujanac M, Southall N, Stebbins CE..  (2013)  Inhibitors of the Yersinia protein tyrosine phosphatase through high throughput and virtual screening approaches.,  23  (4): [PMID:23294700] [10.1016/j.bmcl.2012.12.018]

Source