The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-bromo-4,5,6-trichloro-1-(2,3,5-tri-O-acetyl-beta-D-ribofuranosyl)benzimidazole ID: ALA1650581
PubChem CID: 53323191
Max Phase: Preclinical
Molecular Formula: C18H16BrCl3N2O7
Molecular Weight: 558.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)OC[C@H]1O[C@@H](n2c(Br)nc3c(Cl)c(Cl)c(Cl)cc32)[C@H](OC(C)=O)[C@@H]1OC(C)=O
Standard InChI: InChI=1S/C18H16BrCl3N2O7/c1-6(25)28-5-11-15(29-7(2)26)16(30-8(3)27)17(31-11)24-10-4-9(20)12(21)13(22)14(10)23-18(24)19/h4,11,15-17H,5H2,1-3H3/t11-,15-,16-,17-/m1/s1
Standard InChI Key: IXBNBIINIMMUIN-GAEVZRCVSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
-0.6934 -0.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9406 -1.5354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2708 -2.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3933 -1.5276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1339 -0.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6173 -0.0764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1790 -1.7779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2660 -2.8410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3931 1.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3943 0.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6794 -0.2319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6812 1.4211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9659 1.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9656 0.1810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1751 -0.0756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6868 0.5969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1756 1.2690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1382 0.5972 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-4.1077 1.4207 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.1091 -0.2309 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.9781 -3.2577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4423 -0.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8496 0.6471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8600 -0.7818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1526 -2.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8537 -3.0378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4254 -2.9926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6950 -2.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4070 -3.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6998 -2.0244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6836 2.2461 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 8 1 1
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
3 4 1 0
16 18 1 0
4 5 1 0
9 19 1 0
9 10 2 0
10 20 1 0
1 15 1 1
5 1 1 0
8 21 1 0
10 11 1 0
6 22 1 0
11 14 2 0
22 23 1 0
22 24 2 0
13 12 2 0
7 25 1 0
12 9 1 0
25 26 2 0
13 14 1 0
25 27 1 0
5 6 1 6
21 28 1 0
1 2 1 0
28 29 1 0
4 7 1 6
28 30 2 0
12 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.60Molecular Weight (Monoisotopic): 555.9206AlogP: 4.08#Rotatable Bonds: 5Polar Surface Area: 105.95Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.42CX LogP: 3.90CX LogD: 3.90Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.31Np Likeness Score: 0.55
References 1. Hwang JS, Schilf R, Drach JC, Townsend LB, Bogner E.. (2009) Susceptibilities of human cytomegalovirus clinical isolates and other herpesviruses to new acetylated, tetrahalogenated benzimidazole D-ribonucleosides., 53 (12): [PMID:19786605 ] [10.1128/aac.00809-09 ]