N1-[(E)-5-Dihydroxyphosphonyl-pent-2-enyl]-5-chlorouracil

ID: ALA1650760

PubChem CID: 50994032

Max Phase: Preclinical

Molecular Formula: C9H12ClN2O5P

Molecular Weight: 294.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1[nH]c(=O)n(C/C=C/CCP(=O)(O)O)cc1Cl

Standard InChI:  InChI=1S/C9H12ClN2O5P/c10-7-6-12(9(14)11-8(7)13)4-2-1-3-5-18(15,16)17/h1-2,6H,3-5H2,(H,11,13,14)(H2,15,16,17)/b2-1+

Standard InChI Key:  JYEPAZFBJFKASZ-OWOJBTEDSA-N

Molfile:  

     RDKit          2D

 18 18  0  0  0  0  0  0  0  0999 V2000
    1.4282  -13.1483    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    4.2776  -10.6790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2776  -11.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9900  -11.9129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7019  -11.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7022  -10.6790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9900  -10.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9900   -9.4371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4165  -11.9173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9900  -12.7378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2754  -13.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5610  -12.7378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8500  -13.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1392  -12.7378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7173  -12.7377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282  -13.9692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7126  -13.5552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5620  -10.2686    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  5  9  2  0
  4 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14  1  1  0
  1 15  1  0
  2  3  2  0
  1 16  2  0
  2  7  1  0
  1 17  1  0
  3  4  1  0
  2 18  1  0
M  END

Associated Targets(Human)

DTYMK Tbio Thymidylate kinase (169 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 294.63Molecular Weight (Monoisotopic): 294.0172AlogP: 0.31#Rotatable Bonds: 5
Polar Surface Area: 112.39Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 1.81CX Basic pKa: CX LogP: -0.23CX LogD: -2.60
Aromatic Rings: 1Heavy Atoms: 18QED Weighted: 0.53Np Likeness Score: -0.01

References

1. Topalis D, Pradère U, Roy V, Caillat C, Azzouzi A, Broggi J, Snoeck R, Andrei G, Lin J, Eriksson S, Alexandre JA, El-Amri C, Deville-Bonne D, Meyer P, Balzarini J, Agrofoglio LA..  (2011)  Novel antiviral C5-substituted pyrimidine acyclic nucleoside phosphonates selected as human thymidylate kinase substrates.,  54  (1): [PMID:21128666] [10.1021/jm1011462]

Source