3-(3-Fluorophenyl)amino-2-nitro-3-oxopropionitrile potassium salt

ID: ALA1651804

PubChem CID: 51031077

Max Phase: Preclinical

Molecular Formula: C9H5FKN3O3

Molecular Weight: 222.16

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#CC(C(=O)Nc1cccc(F)c1)=[N+]([O-])[O-].[K+]

Standard InChI:  InChI=1S/C9H5FN3O3.K/c10-6-2-1-3-7(4-6)12-9(14)8(5-11)13(15)16;/h1-4H,(H-,12,14,15,16);/q-1;+1

Standard InChI Key:  OAKNMTZJMBFNNY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 17 16  0  0  0  0  0  0  0  0999 V2000
   -6.1875  -23.4062    0.0000 K   0  0  0  0  0 15  0  0  0  0  0  0
   -2.5749  -20.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5761  -21.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8617  -21.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1456  -21.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1485  -20.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8635  -20.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2905  -21.8889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0041  -21.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7185  -21.8874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0035  -20.6516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4984  -21.6172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7356  -22.7117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2874  -21.3470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0273  -23.1407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4551  -23.1110    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4309  -21.8878    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
  9 10  1  0
  5  6  1  0
  9 11  2  0
  3  4  1  0
  6  7  2  0
 10 12  1  0
 13 10  2  0
  7  2  1  0
 12 14  3  0
  2  3  2  0
  3  8  1  0
 13 15  1  0
 13 16  1  0
  4  5  2  0
  5 17  1  0
M  CHG  4   1   1  13   1  15  -1  16  -1
M  END

Associated Targets(non-human)

Dhodh Dihydroorotate dehydrogenase (165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 222.16Molecular Weight (Monoisotopic): 222.0320AlogP: 0.74#Rotatable Bonds: 2
Polar Surface Area: 102.02Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: -6.86CX Basic pKa: 1.54CX LogP: -1.58CX LogD: -1.82
Aromatic Rings: 1Heavy Atoms: 16QED Weighted: 0.45Np Likeness Score: -1.95

References

1. Giorgis M, Lolli ML, Rolando B, Rao A, Tosco P, Chaurasia S, Marabello D, Fruttero R, Gasco A..  (2011)  1,2,5-Oxadiazole analogues of leflunomide and related compounds.,  46  (1): [PMID:21109332] [10.1016/j.ejmech.2010.10.029]

Source