(R,S)2-[4-(Bis(4-fluorophenyl)methyl)piperazin-1-yl]-4-hydroxy-N-(4-methoxylbenzyl)butanamide

ID: ALA1651896

PubChem CID: 51031486

Max Phase: Preclinical

Molecular Formula: C29H33F2N3O3

Molecular Weight: 509.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CNC(=O)C(CCO)N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1

Standard InChI:  InChI=1S/C29H33F2N3O3/c1-37-26-12-2-21(3-13-26)20-32-29(36)27(14-19-35)33-15-17-34(18-16-33)28(22-4-8-24(30)9-5-22)23-6-10-25(31)11-7-23/h2-13,27-28,35H,14-20H2,1H3,(H,32,36)

Standard InChI Key:  TWLMFIIBVTZWOS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    1.3614   -0.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6497   -1.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6497   -2.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3614   -2.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0772   -1.3780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3614   -0.1405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0772    0.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7931   -0.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5048    0.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2207   -0.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2207   -0.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5048   -1.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7931   -0.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9365   -1.3780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6482   -0.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0772   -2.2030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0662   -0.9655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7821   -1.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4938   -0.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4938   -0.1405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7821    0.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0662   -0.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2096    0.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9255   -0.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9255   -0.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6372   -1.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3531   -0.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3531   -0.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6372    0.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0689   -1.3780    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2096    1.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9255    1.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9255    2.3387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2096    2.7512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4938    2.3387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4938    1.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2096    3.5762    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  1  5  2  0
  1  6  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  8 13  2  0
 14 15  1  0
 11 14  1  0
  6  7  1  0
  4 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 17 22  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 27 30  1  0
 23 24  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 31 36  2  0
 34 37  1  0
 23 31  1  0
 20 23  1  0
  2 17  1  0
M  END

Associated Targets(Human)

SLC6A11 Tchem GABA transporter 3 (176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC6A13 Tchem GABA transporter 2 (120 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC6A1 Tclin GABA transporter 1 (308 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Slc6a1 GABA transporter 1 (1980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.60Molecular Weight (Monoisotopic): 509.2490AlogP: 3.75#Rotatable Bonds: 10
Polar Surface Area: 65.04Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.53CX LogP: 3.87CX LogD: 3.82
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: -0.85

References

1. Kulig K, Więckowski K, Więckowska A, Gajda J, Pochwat B, Höfner GC, Wanner KT, Malawska B..  (2011)  Synthesis and biological evaluation of new derivatives of 2-substituted 4-hydroxybutanamides as GABA uptake inhibitors.,  46  (1): [PMID:21111516] [10.1016/j.ejmech.2010.11.001]

Source