(R,S)2-[4-(Bis(4-fluorophenyl)methyl)piperazin-1-yl]-4-hydroxy-N-phenethylbutanamide

ID: ALA1651897

PubChem CID: 51031487

Max Phase: Preclinical

Molecular Formula: C29H33F2N3O2

Molecular Weight: 493.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCc1ccccc1)C(CCO)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1

Standard InChI:  InChI=1S/C29H33F2N3O2/c30-25-10-6-23(7-11-25)28(24-8-12-26(31)13-9-24)34-19-17-33(18-20-34)27(15-21-35)29(36)32-16-14-22-4-2-1-3-5-22/h1-13,27-28,35H,14-21H2,(H,32,36)

Standard InChI Key:  JKBVUZUVGAQOKX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   14.0095   -0.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2978   -1.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2978   -2.2321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0095   -2.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7254   -1.4071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0095   -0.1696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7254    0.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7254    1.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4413    1.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4413    2.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1529    2.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8688    2.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8688    1.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1529    1.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7254   -2.2321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5820   -0.9946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8703   -1.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1544   -0.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1544   -0.1696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8703    0.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5820   -0.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4385    0.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7227   -0.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7227   -0.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0110   -1.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2951   -0.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2951   -0.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0110    0.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5792   -1.4071    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.4385    1.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7227    1.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7227    2.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4385    2.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1544    2.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1544    1.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4385    3.5470    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  1  5  2  0
  1  6  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
  6  7  1  0
  4 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 16 21  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 26 29  1  0
 22 23  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 30 35  2  0
 33 36  1  0
 22 30  1  0
 19 22  1  0
  2 16  1  0
M  END

Associated Targets(Human)

SLC6A11 Tchem GABA transporter 3 (176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC6A13 Tchem GABA transporter 2 (120 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC6A1 Tclin GABA transporter 1 (308 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Slc6a1 GABA transporter 1 (1980 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.60Molecular Weight (Monoisotopic): 493.2541AlogP: 3.78#Rotatable Bonds: 10
Polar Surface Area: 55.81Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.54CX LogP: 4.32CX LogD: 4.26
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.45Np Likeness Score: -0.76

References

1. Kulig K, Więckowski K, Więckowska A, Gajda J, Pochwat B, Höfner GC, Wanner KT, Malawska B..  (2011)  Synthesis and biological evaluation of new derivatives of 2-substituted 4-hydroxybutanamides as GABA uptake inhibitors.,  46  (1): [PMID:21111516] [10.1016/j.ejmech.2010.11.001]

Source