The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[4-(2-Amino-4-oxo-3,4a,7,8a-tetrahydro-4H-pyrimido[4,5-b][1,4]oxazin-6-ylmethyl)-benzoylamino]-pentanedioic acid ID: ALA16681
PubChem CID: 44270910
Max Phase: Preclinical
Molecular Formula: C19H21N5O7
Molecular Weight: 431.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC1=NC(=O)C2N=C(Cc3ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc3)COC2N1
Standard InChI: InChI=1S/C19H21N5O7/c20-19-23-16(28)14-17(24-19)31-8-11(21-14)7-9-1-3-10(4-2-9)15(27)22-12(18(29)30)5-6-13(25)26/h1-4,12,14,17H,5-8H2,(H,22,27)(H,25,26)(H,29,30)(H3,20,23,24,28)
Standard InChI Key: RDGQBRHIWMVSEW-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
1.3792 -5.0542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0917 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6667 -3.8167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3792 -3.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6667 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0875 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8042 -3.4042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0667 -5.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0500 -5.9292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8000 -5.0542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5167 -3.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4792 -5.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7542 -6.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3542 -4.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0042 -8.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3792 -2.5792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7875 -4.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4917 -5.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0458 -5.0542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2875 -8.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5167 -4.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7417 -7.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3667 -3.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6375 -5.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2292 -3.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0250 -7.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1875 -6.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9417 -3.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7167 -8.8292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6667 -3.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9292 -4.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 5 2 0
4 2 1 0
5 1 1 0
6 1 1 0
7 2 1 0
8 14 1 0
9 8 1 0
10 6 1 0
11 21 1 0
12 13 1 0
13 9 1 0
14 24 2 0
15 26 1 0
16 4 2 0
17 8 2 0
18 12 2 0
19 5 1 0
20 15 2 0
21 10 1 0
22 13 1 0
23 30 2 0
24 31 1 0
25 11 1 0
26 22 1 0
27 12 1 0
28 25 1 0
29 15 1 0
30 28 1 0
31 28 2 0
4 3 1 0
7 11 2 0
23 14 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.41Molecular Weight (Monoisotopic): 431.1441AlogP: -1.11#Rotatable Bonds: 8Polar Surface Area: 192.77Molecular Species: ACIDHBA: 8HBD: 5#RO5 Violations: ┄HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.32CX Basic pKa: 6.33CX LogP: -2.22CX LogD: -6.29Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.34Np Likeness Score: 0.12
References 1. Nair MG, Salter OC, Kisliuk RL, Gaumont Y, North G.. (1983) Folate analogues. 22. Synthesis and biological evaluation of two analogues of dihydrofolic acid possessing a 7,8-dihydro-8-oxapterin ring system., 26 (8): [PMID:6410065 ] [10.1021/jm00362a015 ]