The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-hydroxy-N'-(1-(3-nitrobenzyl)-2-oxoindolin-3-ylidene)-2-naphthohydrazide ID: ALA1668294
PubChem CID: 1049729
Max Phase: Preclinical
Molecular Formula: C26H18N4O5
Molecular Weight: 466.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N/N=C1\C(=O)N(Cc2cccc([N+](=O)[O-])c2)c2ccccc21)c1cc2ccccc2cc1O
Standard InChI: InChI=1S/C26H18N4O5/c31-23-14-18-8-2-1-7-17(18)13-21(23)25(32)28-27-24-20-10-3-4-11-22(20)29(26(24)33)15-16-6-5-9-19(12-16)30(34)35/h1-14,31H,15H2,(H,28,32)/b27-24-
Standard InChI Key: SDSZXOTXZSTSSE-PNHLSOANSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
11.3373 -10.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1629 -10.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5592 -11.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3839 -11.1141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8118 -10.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4047 -9.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5812 -9.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8291 -8.9742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4245 -8.2505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6553 -8.9827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5834 -8.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5823 -9.2841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2983 -9.6994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2965 -8.0451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0088 -8.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0096 -9.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7261 -9.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4423 -9.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4375 -8.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7204 -8.0400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1595 -9.6883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1506 -8.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8687 -8.4369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1456 -7.2048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5819 -8.0218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2587 -8.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1732 -9.3127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9295 -9.6475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4637 -9.7310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0671 -8.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4769 -9.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2995 -9.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7133 -8.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2945 -7.6016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4732 -7.6057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 18 2 0
4 5 2 0
18 19 1 0
8 9 2 0
19 20 2 0
20 15 1 0
8 10 1 0
18 21 1 0
2 3 2 0
19 22 1 0
5 6 1 0
22 23 1 0
11 12 2 0
22 24 2 0
1 2 1 0
23 25 1 0
12 13 1 0
25 26 2 0
26 27 1 0
13 16 2 0
6 7 2 0
27 28 1 0
28 31 1 0
30 26 1 0
15 14 2 0
27 29 2 0
14 11 1 0
7 2 1 0
30 31 2 0
3 4 1 0
31 32 1 0
15 16 1 0
32 33 2 0
6 8 1 0
33 34 1 0
16 17 1 0
34 35 2 0
35 30 1 0
28 1 1 0
M CHG 2 8 1 10 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.45Molecular Weight (Monoisotopic): 466.1277AlogP: 4.13#Rotatable Bonds: 5Polar Surface Area: 125.14Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.80CX Basic pKa: ┄CX LogP: 5.09CX LogD: 4.95Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -1.44
References 1. Chu Y, Chen X, Yang Y, Tang Y.. (2011) Identification of small molecular inhibitors for Ero1p by structure-based virtual screening., 21 (4): [PMID:21269829 ] [10.1016/j.bmcl.2010.12.129 ]