2-(4,5-dinitro-1H-imidazol-1-yl)-N-(3-nitro-5-phenoxyphenyl)acetamide

ID: ALA1668295

Cas Number: 326893-00-9

PubChem CID: 4661288

Max Phase: Preclinical

Molecular Formula: C17H12N6O8

Molecular Weight: 428.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cn1cnc([N+](=O)[O-])c1[N+](=O)[O-])Nc1cc(Oc2ccccc2)cc([N+](=O)[O-])c1

Standard InChI:  InChI=1S/C17H12N6O8/c24-15(9-20-10-18-16(22(27)28)17(20)23(29)30)19-11-6-12(21(25)26)8-14(7-11)31-13-4-2-1-3-5-13/h1-8,10H,9H2,(H,19,24)

Standard InChI Key:  VDIJECJEMCBPPP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   -1.5699  -14.2966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1662  -15.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3420  -15.0234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0770  -14.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3342  -13.5916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1571  -13.5882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0644  -15.7413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8894  -15.7483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0815  -12.8789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3254  -12.1582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9089  -12.8782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2911  -16.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1153  -16.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5346  -15.7632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1238  -15.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3009  -15.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3948  -14.2898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8132  -15.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6381  -14.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4066  -15.7187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1169  -15.6664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9444  -15.6754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1919  -16.4624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5198  -16.9409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8571  -16.4496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0705  -16.6983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5118  -17.7659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4589  -16.1418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8896  -17.5043    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7943  -18.1730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2232  -18.1868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
 15 16  2  0
 16  8  1  0
  7  8  1  0
  1 17  1  0
 17 18  1  0
  5  9  1  0
 18 19  1  0
  4  5  1  0
 18 20  2  0
  2  3  1  0
 19 21  1  0
 21 22  1  0
  9 10  2  0
  9 11  1  0
  5  6  2  0
  8 12  2  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 21  1  0
  6  1  1  0
 25 26  1  0
 12 13  1  0
 24 27  1  0
  1  2  2  0
 13 14  2  0
 26 28  2  0
 26 29  1  0
  3  7  1  0
 14 15  1  0
 27 30  2  0
 27 31  1  0
M  CHG  6   9   1  11  -1  26   1  27   1  29  -1  31  -1
M  END

Associated Targets(Human)

ERO1A Tbio ERO1-like protein alpha (22 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.32Molecular Weight (Monoisotopic): 428.0717AlogP: 3.04#Rotatable Bonds: 8
Polar Surface Area: 185.57Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: HBA (Lipinski): 14HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.30CX Basic pKa: CX LogP: 2.99CX LogD: 2.99
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -1.69

References

1. Chu Y, Chen X, Yang Y, Tang Y..  (2011)  Identification of small molecular inhibitors for Ero1p by structure-based virtual screening.,  21  (4): [PMID:21269829] [10.1016/j.bmcl.2010.12.129]

Source