The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-nitrobenzamido)-9,10-dioxo-9,10-dihydroanthracene-2-carboxylic acid ID: ALA1668296
PubChem CID: 53317020
Max Phase: Preclinical
Molecular Formula: C22H12N2O7
Molecular Weight: 416.35
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cc2c(cc1C(=O)O)C(=O)c1ccccc1C2=O)c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C22H12N2O7/c25-19-13-3-1-2-4-14(13)20(26)16-10-18(17(22(28)29)9-15(16)19)23-21(27)11-5-7-12(8-6-11)24(30)31/h1-10H,(H,23,27)(H,28,29)
Standard InChI Key: SMPMQQJWCBELPW-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
7.2955 -17.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3197 -17.8569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8266 -12.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5447 -13.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5552 -14.1159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8371 -14.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1192 -14.1299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1095 -13.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3934 -12.8937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4083 -12.0693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6774 -13.2897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2435 -14.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9532 -14.1297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9961 -15.7826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0068 -16.5901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7391 -16.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7015 -15.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4261 -15.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4473 -16.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1633 -16.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1271 -15.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8532 -15.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8713 -16.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5942 -16.9228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2978 -16.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2735 -15.6673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5518 -15.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1048 -14.4792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1876 -17.7843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2695 -15.3918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5944 -16.6132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 10 2 0
9 11 1 0
8 9 1 0
5 12 1 0
12 13 2 0
14 15 2 0
15 16 1 0
16 19 2 0
18 17 2 0
17 14 1 0
15 1 1 0
18 19 1 0
18 21 1 0
19 20 1 0
20 23 1 0
22 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 2 0
20 29 2 0
1 2 2 0
12 30 1 0
30 14 1 0
1 31 1 0
M CHG 2 9 1 11 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.35Molecular Weight (Monoisotopic): 416.0645AlogP: 3.32#Rotatable Bonds: 4Polar Surface Area: 143.68Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.08CX Basic pKa: ┄CX LogP: 4.26CX LogD: 0.79Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -0.74
References 1. Chu Y, Chen X, Yang Y, Tang Y.. (2011) Identification of small molecular inhibitors for Ero1p by structure-based virtual screening., 21 (4): [PMID:21269829 ] [10.1016/j.bmcl.2010.12.129 ]