5-(3-ethoxy-4-(2-(naphthalen-1-yloxy)ethoxy)benzylidene)-1-p-tolylpyrimidine-2,4,6(1H,3H,5H)-trione

ID: ALA1668298

PubChem CID: 22307158

Max Phase: Preclinical

Molecular Formula: C32H28N2O6

Molecular Weight: 536.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(C)cc3)C2=O)ccc1OCCOc1cccc2ccccc12

Standard InChI:  InChI=1S/C32H28N2O6/c1-3-38-29-20-22(19-26-30(35)33-32(37)34(31(26)36)24-14-11-21(2)12-15-24)13-16-28(29)40-18-17-39-27-10-6-8-23-7-4-5-9-25(23)27/h4-16,19-20H,3,17-18H2,1-2H3,(H,33,35,37)/b26-19+

Standard InChI Key:  YNEOAPBDKOFDGR-LGUFXXKBSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   -1.2056  -23.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2068  -23.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4919  -24.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2245  -23.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2216  -23.0463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4937  -22.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9396  -24.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6595  -23.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9202  -22.6376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4962  -21.8122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3692  -24.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0870  -23.9081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1020  -23.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3931  -22.6587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6690  -23.0599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9607  -22.6371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8234  -22.6824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3573  -25.1328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7903  -24.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7750  -25.1550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4816  -25.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2039  -25.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2152  -24.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5080  -23.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9119  -25.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2170  -21.3976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2146  -20.5726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6345  -23.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3491  -22.6380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0635  -23.0506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0633  -23.8756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0641  -25.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3473  -25.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3507  -24.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7792  -25.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7805  -24.2879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4928  -23.8793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2124  -24.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2010  -25.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4861  -25.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 19 20  2  0
  6 10  1  0
 20 21  1  0
  8 11  1  0
 21 22  2  0
  2  3  1  0
 22 23  1  0
  5  6  2  0
 23 24  2  0
 24 19  1  0
 12 19  1  0
  6  1  1  0
 22 25  1  0
  1  2  2  0
 10 26  1  0
  4  7  1  0
 26 27  1  0
  8 15  1  0
  9 28  1  0
 11 12  1  0
 28 29  1  0
 12 13  1  0
 29 30  1  0
 13 14  1  0
 30 31  1  0
 31 36  2  0
 14 15  1  0
 35 32  2  0
  3  4  2  0
 32 33  1  0
 15 16  2  0
 33 34  2  0
 34 31  1  0
  7  8  2  0
 13 17  2  0
 35 36  1  0
 36 37  1  0
 11 18  2  0
 37 38  2  0
  1  9  1  0
 38 39  1  0
  4  5  1  0
 39 40  2  0
 40 35  1  0
M  END

Associated Targets(Human)

ERO1A Tbio ERO1-like protein alpha (22 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 536.58Molecular Weight (Monoisotopic): 536.1947AlogP: 5.67#Rotatable Bonds: 9
Polar Surface Area: 94.17Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.56CX Basic pKa: CX LogP: 5.85CX LogD: 4.99
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.17Np Likeness Score: -1.06

References

1. Chu Y, Chen X, Yang Y, Tang Y..  (2011)  Identification of small molecular inhibitors for Ero1p by structure-based virtual screening.,  21  (4): [PMID:21269829] [10.1016/j.bmcl.2010.12.129]

Source