5-(3-methoxy-4-(2-(3-methoxyphenoxy)ethoxy)benzylidene)-1-(4-methoxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione

ID: ALA1668299

PubChem CID: 1800503

Max Phase: Preclinical

Molecular Formula: C28H26N2O8

Molecular Weight: 518.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(N2C(=O)NC(=O)/C(=C\c3ccc(OCCOc4cccc(OC)c4)c(OC)c3)C2=O)cc1

Standard InChI:  InChI=1S/C28H26N2O8/c1-34-20-10-8-19(9-11-20)30-27(32)23(26(31)29-28(30)33)15-18-7-12-24(25(16-18)36-3)38-14-13-37-22-6-4-5-21(17-22)35-2/h4-12,15-17H,13-14H2,1-3H3,(H,29,31,33)/b23-15+

Standard InChI Key:  XYECHHHBJPLCGI-HZHRSRAPSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    7.5319  -21.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5307  -22.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2456  -22.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9620  -22.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9591  -21.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2438  -20.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8159  -22.5726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1018  -22.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6771  -22.5716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3909  -22.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1061  -22.5693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8199  -22.1557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5350  -22.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5319  -23.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2461  -23.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9609  -23.3904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9570  -22.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2421  -22.1535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2376  -21.3286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9498  -20.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6766  -23.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3899  -23.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1013  -23.7995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8125  -23.3885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8144  -22.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0988  -22.1505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3815  -22.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6652  -22.1538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1004  -24.6245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5292  -22.1512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5266  -23.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5215  -24.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2348  -25.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9506  -24.6272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9487  -23.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2348  -23.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6652  -25.0394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3795  -24.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  9  1  0
 18 19  1  0
  4  5  1  0
 19 20  1  0
  9 10  1  0
 16 21  1  0
  2  3  1  0
 21 22  2  0
 22 23  1  0
 10 11  1  0
  5  6  2  0
 11 12  1  0
  6  1  1  0
 12 13  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
  1  2  2  0
 27 28  2  0
 13 14  2  0
 23 29  2  0
  2  7  1  0
 25 30  2  0
 14 15  1  0
 24 31  1  0
  3  4  2  0
 31 32  2  0
 15 16  2  0
 32 33  1  0
  7  8  1  0
 33 34  2  0
 16 17  1  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 17 18  2  0
 34 37  1  0
 18 13  1  0
 37 38  1  0
M  END

Associated Targets(Human)

ERO1A Tbio ERO1-like protein alpha (22 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.52Molecular Weight (Monoisotopic): 518.1689AlogP: 3.84#Rotatable Bonds: 10
Polar Surface Area: 112.63Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.56CX Basic pKa: CX LogP: 3.68CX LogD: 2.81
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -0.95

References

1. Chu Y, Chen X, Yang Y, Tang Y..  (2011)  Identification of small molecular inhibitors for Ero1p by structure-based virtual screening.,  21  (4): [PMID:21269829] [10.1016/j.bmcl.2010.12.129]

Source