The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12-Mercaptododecyl-beta-D-galactopyranosyl-(1->4)-2-deoxy-alpha-D-arabino-hexopyranoside ID: ALA1669630
PubChem CID: 53316935
Max Phase: Preclinical
Molecular Formula: C24H46O10S
Molecular Weight: 526.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: OC[C@H]1O[C@@H](O[C@H]2[C@H](O)C[C@@H](OCCCCCCCCCCCCS)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C24H46O10S/c25-14-17-20(28)21(29)22(30)24(33-17)34-23-16(27)13-19(32-18(23)15-26)31-11-9-7-5-3-1-2-4-6-8-10-12-35/h16-30,35H,1-15H2/t16-,17-,18-,19+,20+,21+,22-,23+,24+/m1/s1
Standard InChI Key: XDAYRUFVBXUGIK-XMODHHRKSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
-3.7374 -9.8531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4529 -10.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4528 -11.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7443 -11.4974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0329 -11.0893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0259 -10.2651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3209 -11.5034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7478 -12.3216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1682 -11.4935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1667 -9.8503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7374 -9.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0273 -8.6187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6071 -10.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6071 -11.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8952 -11.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1832 -11.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1832 -10.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8952 -9.8497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5323 -9.8559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2456 -10.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9611 -9.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6702 -10.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3857 -9.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0989 -10.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8145 -9.8684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5277 -10.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2433 -9.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9565 -10.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6720 -9.8767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3811 -10.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0966 -9.8809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8099 -10.2972 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.8952 -12.3224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3227 -9.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3251 -9.0316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0402 -11.9124 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
3 9 1 1
17 19 1 6
2 3 1 0
19 20 1 0
2 10 1 1
20 21 1 0
3 4 1 0
21 22 1 0
1 11 1 1
22 23 1 0
4 5 1 0
23 24 1 0
11 12 1 0
24 25 1 0
13 14 1 0
25 26 1 0
5 6 1 0
26 27 1 0
27 28 1 0
5 7 1 0
28 29 1 0
1 2 1 0
29 30 1 0
4 8 1 6
30 31 1 0
1 6 1 0
31 32 1 0
13 18 1 0
15 33 1 1
14 7 1 6
14 15 1 0
13 34 1 1
15 16 1 0
34 35 1 0
16 17 1 0
5 36 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.69Molecular Weight (Monoisotopic): 526.2812AlogP: 0.49#Rotatable Bonds: 17Polar Surface Area: 158.30Molecular Species: NEUTRALHBA: 11HBD: 7#RO5 Violations: 3HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.20CX Basic pKa: ┄CX LogP: 1.54CX LogD: 1.53Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.11Np Likeness Score: 1.64
References 1. Murakami T, Yoshioka K, Sato Y, Tanaka M, Niwa O, Yabuki S.. (2011) Synthesis and galectin-binding activities of mercaptododecyl glycosides containing a terminal β-galactosyl group., 21 (4): [PMID:21237642 ] [10.1016/j.bmcl.2010.12.049 ]