The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Ethyl-4-[6-methyl-6-(1H-tetrazol-5-yl)-heptyloxy]-3'-trifluoromethyl-biphenyl-2-ol ID: ALA167580
PubChem CID: 10600128
Max Phase: Preclinical
Molecular Formula: C24H29F3N4O2
Molecular Weight: 462.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc(-c2cccc(C(F)(F)F)c2)c(O)cc1OCCCCCC(C)(C)c1nn[nH]n1
Standard InChI: InChI=1S/C24H29F3N4O2/c1-4-16-14-19(17-9-8-10-18(13-17)24(25,26)27)20(32)15-21(16)33-12-7-5-6-11-23(2,3)22-28-30-31-29-22/h8-10,13-15,32H,4-7,11-12H2,1-3H3,(H,28,29,30,31)
Standard InChI Key: GBQJYQUQMXHDLH-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
9.5167 -3.0167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5667 -3.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2125 -2.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1167 -3.4667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6292 -2.6250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2917 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 -2.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8875 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 -3.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 -2.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8500 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8167 -2.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 -3.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8875 -3.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3375 -2.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0500 -3.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8250 -2.9167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7042 -2.4167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2000 -3.2625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8792 -1.7292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9292 -3.5375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8542 -1.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8125 -1.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3292 -1.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8875 -4.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5292 -3.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7417 -4.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3417 -4.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4500 -3.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0042 -3.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9667 -3.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4875 -3.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4042 -4.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 2 0
3 1 1 0
4 1 1 0
5 3 2 0
6 12 1 0
7 9 2 0
8 10 2 0
9 14 1 0
10 13 1 0
11 7 1 0
12 15 2 0
13 21 1 0
14 13 2 0
15 11 1 0
16 2 1 0
17 6 1 0
18 6 1 0
19 6 1 0
20 8 1 0
21 29 1 0
22 11 2 0
23 24 2 0
24 22 1 0
25 14 1 0
26 16 1 0
27 16 1 0
28 16 1 0
29 31 1 0
30 26 1 0
31 32 1 0
32 30 1 0
33 25 1 0
5 2 1 0
8 7 1 0
12 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.52Molecular Weight (Monoisotopic): 462.2243AlogP: 6.07#Rotatable Bonds: 10Polar Surface Area: 83.92Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.78CX Basic pKa: ┄CX LogP: 7.63CX LogD: 6.33Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -0.59
References 1. Sawyer JS, Bach NJ, Baker SR, Baldwin RF, Borromeo PS, Cockerham SL, Fleisch JH, Floreancig P, Froelich LL, Jackson WT.. (1995) Synthetic and structure/activity studies on acid-substituted 2-arylphenols: discovery of 2-[2-propyl-3-[3-[2-ethyl-4-(4-fluorophenyl)-5- hydroxyphenoxy]-propoxy]phenoxy]benzoic acid, a high-affinity leukotriene B4 receptor antagonist., 38 (22): [PMID:7473568 ] [10.1021/jm00022a006 ] 2. Wikel JH, Sofia MJ, Saussy DL, Bemis KG. (1994) QSAR Study of ortho-phenylphenol leukotriene B4 receptor antagonists, 4 (6): [10.1016/S0960-894X(01)80850-7 ]