5-Ethyl-4'-methoxy-4-[6-methyl-6-(1H-tetrazol-5-yl)-heptyloxy]-biphenyl-2-ol

ID: ALA167972

PubChem CID: 10342316

Max Phase: Preclinical

Molecular Formula: C24H32N4O3

Molecular Weight: 424.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1cc(-c2ccc(OC)cc2)c(O)cc1OCCCCCC(C)(C)c1nn[nH]n1

Standard InChI:  InChI=1S/C24H32N4O3/c1-5-17-15-20(18-9-11-19(30-4)12-10-18)21(29)16-22(17)31-14-8-6-7-13-24(2,3)23-25-27-28-26-23/h9-12,15-16,29H,5-8,13-14H2,1-4H3,(H,25,26,27,28)

Standard InChI Key:  UMCVBCSSWUMWQX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
    9.2417   -3.3042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2917   -3.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9375   -2.7792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8417   -3.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3542   -2.9042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0917   -2.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6125   -2.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0917   -3.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1292   -2.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1292   -3.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6125   -3.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7750   -3.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5750   -2.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5792   -2.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0625   -2.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6042   -2.0167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5375   -2.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6542   -3.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5417   -2.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0542   -1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0167   -1.7167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6125   -4.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2542   -3.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0667   -4.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4667   -4.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1750   -3.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0167   -1.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7292   -3.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6917   -3.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2125   -3.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1292   -4.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  2  0
  3  1  1  0
  4  1  1  0
  5  3  2  0
  6  8  2  0
  7  9  2  0
  8 11  1  0
  9 10  1  0
 10 18  1  0
 11 10  2  0
 12  2  1  0
 13  6  1  0
 14 13  2  0
 15 13  1  0
 16  7  1  0
 17 19  1  0
 18 26  1  0
 19 15  2  0
 20 14  1  0
 21 17  1  0
 22 11  1  0
 23 12  1  0
 24 12  1  0
 25 12  1  0
 26 29  1  0
 27 21  1  0
 28 23  1  0
 29 30  1  0
 30 28  1  0
 31 22  1  0
  5  2  1  0
  7  6  1  0
 20 17  2  0
M  END

Associated Targets(Human)

LTB4R2 Tchem Leukotriene B4 receptor (773 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
LTB4R Tchem Leukotriene B4 receptor 1 (1083 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.55Molecular Weight (Monoisotopic): 424.2474AlogP: 5.06#Rotatable Bonds: 11
Polar Surface Area: 93.15Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.78CX Basic pKa: CX LogP: 6.55CX LogD: 5.25
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -0.24

References

1. Sawyer JS, Bach NJ, Baker SR, Baldwin RF, Borromeo PS, Cockerham SL, Fleisch JH, Floreancig P, Froelich LL, Jackson WT..  (1995)  Synthetic and structure/activity studies on acid-substituted 2-arylphenols: discovery of 2-[2-propyl-3-[3-[2-ethyl-4-(4-fluorophenyl)-5- hydroxyphenoxy]-propoxy]phenoxy]benzoic acid, a high-affinity leukotriene B4 receptor antagonist.,  38  (22): [PMID:7473568] [10.1021/jm00022a006]
2. Wikel JH, Sofia MJ, Saussy DL, Bemis KG.  (1994)  QSAR Study of ortho-phenylphenol leukotriene B4 receptor antagonists,  (6): [10.1016/S0960-894X(01)80850-7]

Source