The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-4-(4-bromothenyloxy)-6-[N-(4-(4-aminobenzyl)anilino)]-5-nitropyrimidine ID: ALA1683164
PubChem CID: 53320184
Max Phase: Preclinical
Molecular Formula: C22H19BrN6O3S
Molecular Weight: 527.40
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccc(Cc2ccc(Nc3nc(N)nc(OCc4cc(Br)cs4)c3[N+](=O)[O-])cc2)cc1
Standard InChI: InChI=1S/C22H19BrN6O3S/c23-15-10-18(33-12-15)11-32-21-19(29(30)31)20(27-22(25)28-21)26-17-7-3-14(4-8-17)9-13-1-5-16(24)6-2-13/h1-8,10,12H,9,11,24H2,(H3,25,26,27,28)
Standard InChI Key: XSRYUJNXUWEJQU-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
8.5777 -0.9208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5766 -1.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2914 -2.1610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0078 -1.7477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0050 -0.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2896 -0.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8618 -2.1601 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7230 -2.1591 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7200 -0.5006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7169 0.3244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4361 -0.9104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2871 0.3170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0004 0.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9979 1.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6673 2.0427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4100 2.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5850 2.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3325 2.0387 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.8929 3.4954 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
10.7242 -2.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0091 -3.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0100 -4.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7257 -4.6325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4419 -4.2145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4374 -3.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7281 -5.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4438 -5.8680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4413 -6.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1561 -7.1031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8704 -6.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8653 -5.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1499 -5.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5866 -7.0980 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
4 5 1 0
16 19 1 0
2 3 1 0
8 20 1 0
9 10 2 0
20 21 2 0
9 11 1 0
21 22 1 0
5 9 1 0
22 23 2 0
5 6 2 0
23 24 1 0
6 12 1 0
24 25 2 0
25 20 1 0
6 1 1 0
23 26 1 0
12 13 1 0
26 27 1 0
1 2 2 0
27 28 2 0
13 14 1 0
28 29 1 0
14 15 2 0
29 30 2 0
2 7 1 0
30 31 1 0
3 4 2 0
31 32 2 0
32 27 1 0
4 8 1 0
30 33 1 0
M CHG 2 9 1 11 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.40Molecular Weight (Monoisotopic): 526.0423AlogP: 5.29#Rotatable Bonds: 8Polar Surface Area: 142.22Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.98CX Basic pKa: 4.59CX LogP: 7.28CX LogD: 7.28Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.16Np Likeness Score: -1.25
References 1. Lopez S, Margison GP, McElhinney RS, Cordeiro A, McMurry TB, Rozas I.. (2011) Towards more specific O6-methylguanine-DNA methyltransferase (MGMT) inactivators., 19 (5): [PMID:21320783 ] [10.1016/j.bmc.2011.01.038 ]