The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-4-(4-bromothenyloxy)-6-[N-(4,4'-aminobenzophenone)]-5-nitropyrimidine ID: ALA1683167
PubChem CID: 53321500
Max Phase: Preclinical
Molecular Formula: C22H17BrN6O4S
Molecular Weight: 541.39
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccc(C(=O)c2ccc(Nc3nc(N)nc(OCc4cc(Br)cs4)c3[N+](=O)[O-])cc2)cc1
Standard InChI: InChI=1S/C22H17BrN6O4S/c23-14-9-17(34-11-14)10-33-21-18(29(31)32)20(27-22(25)28-21)26-16-7-3-13(4-8-16)19(30)12-1-5-15(24)6-2-12/h1-9,11H,10,24H2,(H3,25,26,27,28)
Standard InChI Key: IGZYFNYVXLBLIX-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
7.7569 -9.5541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7557 -10.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4706 -10.7944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1870 -10.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1841 -9.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4688 -9.1414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0409 -10.7934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9021 -10.7924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8992 -9.1339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8961 -8.3089 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6152 -9.5437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4663 -8.3164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1795 -7.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1771 -7.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8465 -6.5906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5892 -5.8068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7641 -5.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5117 -6.5946 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.0721 -5.1379 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
9.9034 -11.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1883 -12.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1892 -12.8537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9049 -13.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6211 -12.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6166 -12.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9073 -14.0909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6229 -14.5013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6204 -15.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3353 -15.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0495 -15.3218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0445 -14.4926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3291 -14.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7657 -15.7313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1940 -14.5054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
4 5 1 0
16 19 1 0
2 3 1 0
8 20 1 0
9 10 2 0
20 21 2 0
9 11 1 0
21 22 1 0
5 9 1 0
22 23 2 0
5 6 2 0
23 24 1 0
6 12 1 0
24 25 2 0
25 20 1 0
6 1 1 0
23 26 1 0
12 13 1 0
26 27 1 0
1 2 2 0
27 28 2 0
13 14 1 0
28 29 1 0
14 15 2 0
29 30 2 0
2 7 1 0
30 31 1 0
3 4 2 0
31 32 2 0
32 27 1 0
4 8 1 0
30 33 1 0
26 34 2 0
M CHG 2 9 1 11 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.39Molecular Weight (Monoisotopic): 540.0215AlogP: 4.93#Rotatable Bonds: 8Polar Surface Area: 159.29Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.96CX Basic pKa: 3.96CX LogP: 6.65CX LogD: 6.65Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.12Np Likeness Score: -1.30
References 1. Lopez S, Margison GP, McElhinney RS, Cordeiro A, McMurry TB, Rozas I.. (2011) Towards more specific O6-methylguanine-DNA methyltransferase (MGMT) inactivators., 19 (5): [PMID:21320783 ] [10.1016/j.bmc.2011.01.038 ]