The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-4-benzyloxy-6-[N-(4-(4-aminobenzyl)anilino)]-5-nitropyrimidine ID: ALA1683168
PubChem CID: 53324160
Max Phase: Preclinical
Molecular Formula: C24H22N6O3
Molecular Weight: 442.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccc(Cc2ccc(Nc3nc(N)nc(OCc4ccccc4)c3[N+](=O)[O-])cc2)cc1
Standard InChI: InChI=1S/C24H22N6O3/c25-19-10-6-16(7-11-19)14-17-8-12-20(13-9-17)27-22-21(30(31)32)23(29-24(26)28-22)33-15-18-4-2-1-3-5-18/h1-13H,14-15,25H2,(H3,26,27,28,29)
Standard InChI Key: DCHXFIWIXOKSMG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
14.4736 -9.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4724 -9.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1872 -10.3402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9037 -9.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9008 -9.0963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1854 -8.6872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7576 -10.3393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6188 -10.3382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6159 -8.6798 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6128 -7.8548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3319 -9.0896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1830 -7.8622 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8962 -7.4476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8937 -6.6226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6201 -11.1632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9049 -11.5753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9059 -12.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6215 -12.8117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3377 -12.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3333 -11.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6239 -13.6367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3396 -14.0471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3371 -14.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0519 -15.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7662 -14.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7611 -14.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0457 -13.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4824 -15.2771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6088 -6.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6067 -5.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8905 -4.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1749 -5.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1805 -6.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 8 1 0
16 17 1 0
17 18 2 0
4 5 1 0
18 19 1 0
2 3 1 0
19 20 2 0
20 15 1 0
9 10 2 0
18 21 1 0
9 11 1 0
21 22 1 0
5 9 1 0
22 23 2 0
5 6 2 0
23 24 1 0
6 12 1 0
24 25 2 0
6 1 1 0
25 26 1 0
12 13 1 0
26 27 2 0
27 22 1 0
1 2 2 0
25 28 1 0
13 14 1 0
14 29 2 0
2 7 1 0
29 30 1 0
8 15 1 0
30 31 2 0
3 4 2 0
31 32 1 0
15 16 2 0
32 33 2 0
33 14 1 0
M CHG 2 9 1 11 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.48Molecular Weight (Monoisotopic): 442.1753AlogP: 4.46#Rotatable Bonds: 8Polar Surface Area: 142.22Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.99CX Basic pKa: 4.60CX LogP: 6.60CX LogD: 6.60Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.21Np Likeness Score: -0.86
References 1. Lopez S, Margison GP, McElhinney RS, Cordeiro A, McMurry TB, Rozas I.. (2011) Towards more specific O6-methylguanine-DNA methyltransferase (MGMT) inactivators., 19 (5): [PMID:21320783 ] [10.1016/j.bmc.2011.01.038 ]