The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-4-benzyloxy-6-[N-(4-(4-aminophenoxy)anilino)]-5-nitropyrimidine ID: ALA1683170
PubChem CID: 53317587
Max Phase: Preclinical
Molecular Formula: C23H20N6O4
Molecular Weight: 444.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccc(Oc2ccc(Nc3nc(N)nc(OCc4ccccc4)c3[N+](=O)[O-])cc2)cc1
Standard InChI: InChI=1S/C23H20N6O4/c24-16-6-10-18(11-7-16)33-19-12-8-17(9-13-19)26-21-20(29(30)31)22(28-23(25)27-21)32-14-15-4-2-1-3-5-15/h1-13H,14,24H2,(H3,25,26,27,28)
Standard InChI Key: FVZNMXVMBVYCQN-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
2.8861 -20.0416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8849 -20.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5997 -21.2819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3162 -20.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3133 -20.0380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5979 -19.6289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1701 -21.2809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0313 -21.2799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0284 -19.6214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0253 -18.7964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7444 -20.0312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5955 -18.8039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3087 -18.3892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3062 -17.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0326 -22.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3174 -22.5169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3184 -23.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0340 -23.7534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7502 -23.3353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7458 -22.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0364 -24.5784 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7521 -24.9888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7496 -25.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4644 -26.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1787 -25.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1736 -24.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4582 -24.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8949 -26.2188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0213 -17.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0192 -16.3299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3030 -15.9187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5874 -16.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5930 -17.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 8 1 0
16 17 1 0
17 18 2 0
4 5 1 0
18 19 1 0
2 3 1 0
19 20 2 0
20 15 1 0
9 10 2 0
18 21 1 0
9 11 1 0
21 22 1 0
5 9 1 0
22 23 2 0
5 6 2 0
23 24 1 0
6 12 1 0
24 25 2 0
6 1 1 0
25 26 1 0
12 13 1 0
26 27 2 0
27 22 1 0
1 2 2 0
25 28 1 0
13 14 1 0
14 29 2 0
2 7 1 0
29 30 1 0
8 15 1 0
30 31 2 0
3 4 2 0
31 32 1 0
15 16 2 0
32 33 2 0
33 14 1 0
M CHG 2 9 1 11 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.45Molecular Weight (Monoisotopic): 444.1546AlogP: 4.66#Rotatable Bonds: 8Polar Surface Area: 151.45Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.24CX Basic pKa: 4.46CX LogP: 6.01CX LogD: 6.01Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.20Np Likeness Score: -0.94
References 1. Lopez S, Margison GP, McElhinney RS, Cordeiro A, McMurry TB, Rozas I.. (2011) Towards more specific O6-methylguanine-DNA methyltransferase (MGMT) inactivators., 19 (5): [PMID:21320783 ] [10.1016/j.bmc.2011.01.038 ]