6-((4-bromothiophen-2-yl)methoxy)-5-nitropyrimidine-2,4-diamine

ID: ALA1683172

PubChem CID: 53326717

Max Phase: Preclinical

Molecular Formula: C9H8BrN5O3S

Molecular Weight: 346.17

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1nc(N)c([N+](=O)[O-])c(OCc2cc(Br)cs2)n1

Standard InChI:  InChI=1S/C9H8BrN5O3S/c10-4-1-5(19-3-4)2-18-8-6(15(16)17)7(11)13-9(12)14-8/h1,3H,2H2,(H4,11,12,13,14)

Standard InChI Key:  DDWBJDZRQLTHLM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 19 20  0  0  0  0  0  0  0  0999 V2000
   15.6361  -20.5708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6349  -21.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3497  -21.8110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3479  -20.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9201  -21.8101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0633  -20.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0681  -21.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3455  -19.3330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6298  -18.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6273  -18.0977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2900  -17.6106    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.0327  -16.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2077  -16.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9552  -17.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7207  -16.1633    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   17.7769  -20.1503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7728  -19.3253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.4934  -20.5592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7844  -21.8030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  9 10  1  0
 10 11  1  0
  2  5  1  0
  6  7  1  0
  2  3  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  3  7  2  0
 13 15  1  0
  1  2  2  0
  4  8  1  0
  6  4  2  0
 16 17  2  0
 16 18  1  0
  6 16  1  0
  8  9  1  0
  7 19  1  0
M  CHG  2  16   1  18  -1
M  END

Associated Targets(Human)

MGMT Tchem 6-O-methylguanine-DNA methyltransferase (451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.17Molecular Weight (Monoisotopic): 344.9531AlogP: 1.95#Rotatable Bonds: 4
Polar Surface Area: 130.19Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.05CX LogP: 3.10CX LogD: 3.10
Aromatic Rings: 2Heavy Atoms: 19QED Weighted: 0.64Np Likeness Score: -1.68

References

1. Lopez S, Margison GP, McElhinney RS, Cordeiro A, McMurry TB, Rozas I..  (2011)  Towards more specific O6-methylguanine-DNA methyltransferase (MGMT) inactivators.,  19  (5): [PMID:21320783] [10.1016/j.bmc.2011.01.038]

Source