(S)-4-((S)-1-Carboxy-ethylcarbamoyl)-2-{4-[(2-methyl-4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-prop-2-ynyl-amino]-benzoylamino}-butyric acid

ID: ALA168450

PubChem CID: 135474792

Max Phase: Preclinical

Molecular Formula: C28H29N5O7

Molecular Weight: 547.57

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C#CCN(Cc1ccc2nc(C)nc(O)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)N[C@@H](C)C(=O)O)C(=O)O)cc1

Standard InChI:  InChI=1S/C28H29N5O7/c1-4-13-33(15-18-5-10-22-21(14-18)26(36)31-17(3)30-22)20-8-6-19(7-9-20)25(35)32-23(28(39)40)11-12-24(34)29-16(2)27(37)38/h1,5-10,14,16,23H,11-13,15H2,2-3H3,(H,29,34)(H,32,35)(H,37,38)(H,39,40)(H,30,31,36)/t16-,23-/m0/s1

Standard InChI Key:  KWTPVLRPVDASNH-HJPURHCSSA-N

Molfile:  

     RDKit          2D

 40 42  0  0  1  0  0  0  0  0999 V2000
    1.1042   -4.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8167   -5.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3792   -5.3375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1042   -6.5750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8167   -6.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3792   -6.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5542   -3.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2667   -4.0500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8417   -5.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9667   -1.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0292   -2.4417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -5.3125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4167   -6.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0042   -4.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7292   -3.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1292   -6.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5292   -4.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8292   -4.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5292   -1.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0917   -4.0875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9667   -4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5417   -2.8125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -5.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5417   -5.6875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4417   -0.4542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5417   -6.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2542   -3.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8417   -4.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1042   -3.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4042   -4.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1167   -5.3125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7542   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9167   -3.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6917   -6.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0792   -5.5875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7917   -1.0500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -6.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3333   -6.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7042   -1.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  2  0
  4  6  2  0
  5  2  2  0
  6  3  1  0
  7 18  1  0
  8  7  1  0
  9 14  1  0
 10 19  1  0
 11 15  1  0
 12 22  1  0
 13 35  1  0
 14  8  1  0
 15 34  1  0
 16 13  3  0
 17  2  1  0
 18 29  2  0
 19 11  1  0
 20 12  1  0
 21  1  1  0
 22 24  1  0
 23  7  2  0
 24 17  2  0
 25  9  2  0
 26 10  2  0
 27  5  1  0
 28 15  2  0
 29 32  1  0
 30 31  2  0
 31 20  1  0
 32 20  2  0
 14 33  1  1
 34 33  1  0
 35 12  1  0
 36  9  1  0
 37 10  1  0
 38 24  1  0
 39  6  1  0
 19 40  1  1
  4  5  1  0
 27 38  2  0
 18 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA168450

    ---

Associated Targets(non-human)

Tyms Thymidylate synthase (842 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L1210 (RD1694) (36 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 547.57Molecular Weight (Monoisotopic): 547.2067AlogP: 1.84#Rotatable Bonds: 12
Polar Surface Area: 182.05Molecular Species: ACIDHBA: 8HBD: 5
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.15CX Basic pKa: 1.75CX LogP: 2.41CX LogD: -4.16
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.00

References

1. Bavetsias V, Jackman AL, Kimbell R, Gibson W, Boyle FT, Bisset GM..  (1996)  Quinazoline antifolate thymidylate synthase inhibitors: gamma-linked L-D, D-D, and D-L dipeptide analogues of 2-desamino-2-methyl-N10-propargyl-5,8-dideazafolic acid (ICI 198583).,  39  (1): [PMID:8568829] [10.1021/jm950471+]

Source