The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-((S)-1-Carboxy-ethylcarbamoyl)-2-{4-[(2-methyl-4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-prop-2-ynyl-amino]-benzoylamino}-butyric acid ID: ALA168450
PubChem CID: 135474792
Max Phase: Preclinical
Molecular Formula: C28H29N5O7
Molecular Weight: 547.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C#CCN(Cc1ccc2nc(C)nc(O)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)N[C@@H](C)C(=O)O)C(=O)O)cc1
Standard InChI: InChI=1S/C28H29N5O7/c1-4-13-33(15-18-5-10-22-21(14-18)26(36)31-17(3)30-22)20-8-6-19(7-9-20)25(35)32-23(28(39)40)11-12-24(34)29-16(2)27(37)38/h1,5-10,14,16,23H,11-13,15H2,2-3H3,(H,29,34)(H,32,35)(H,37,38)(H,39,40)(H,30,31,36)/t16-,23-/m0/s1
Standard InChI Key: KWTPVLRPVDASNH-HJPURHCSSA-N
Molfile:
RDKit 2D
40 42 0 0 1 0 0 0 0 0999 V2000
1.1042 -4.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8167 -5.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3792 -5.3375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1042 -6.5750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8167 -6.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3792 -6.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5542 -3.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2667 -4.0500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8417 -5.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9667 -1.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0292 -2.4417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6917 -5.3125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4167 -6.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0042 -4.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7292 -3.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1292 -6.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5292 -4.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -4.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5292 -1.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -4.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0917 -4.0875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9667 -4.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5417 -2.8125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2542 -5.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5417 -5.6875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4417 -0.4542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5417 -6.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2542 -3.8625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8417 -4.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1042 -3.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -4.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1167 -5.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7542 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9167 -3.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6917 -6.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0792 -5.5875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7917 -1.0500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2542 -6.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3333 -6.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7042 -1.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 6 2 0
5 2 2 0
6 3 1 0
7 18 1 0
8 7 1 0
9 14 1 0
10 19 1 0
11 15 1 0
12 22 1 0
13 35 1 0
14 8 1 0
15 34 1 0
16 13 3 0
17 2 1 0
18 29 2 0
19 11 1 0
20 12 1 0
21 1 1 0
22 24 1 0
23 7 2 0
24 17 2 0
25 9 2 0
26 10 2 0
27 5 1 0
28 15 2 0
29 32 1 0
30 31 2 0
31 20 1 0
32 20 2 0
14 33 1 1
34 33 1 0
35 12 1 0
36 9 1 0
37 10 1 0
38 24 1 0
39 6 1 0
19 40 1 1
4 5 1 0
27 38 2 0
18 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.57Molecular Weight (Monoisotopic): 547.2067AlogP: 1.84#Rotatable Bonds: 12Polar Surface Area: 182.05Molecular Species: ACIDHBA: 8HBD: 5#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.15CX Basic pKa: 1.75CX LogP: 2.41CX LogD: -4.16Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.00
References 1. Bavetsias V, Jackman AL, Kimbell R, Gibson W, Boyle FT, Bisset GM.. (1996) Quinazoline antifolate thymidylate synthase inhibitors: gamma-linked L-D, D-D, and D-L dipeptide analogues of 2-desamino-2-methyl-N10-propargyl-5,8-dideazafolic acid (ICI 198583)., 39 (1): [PMID:8568829 ] [10.1021/jm950471+ ]