N-(4-(5-Amino-1-(4-methoxybenzyl)-1H-pyrazol-4-ylcarbamoyl)-3-methylphenyl)-5-methylisoxazole-3-carboxamide

ID: ALA1684792

PubChem CID: 53322328

Max Phase: Preclinical

Molecular Formula: C24H24N6O4

Molecular Weight: 460.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cn2ncc(NC(=O)c3ccc(NC(=O)c4cc(C)on4)cc3C)c2N)cc1

Standard InChI:  InChI=1S/C24H24N6O4/c1-14-10-17(27-24(32)20-11-15(2)34-29-20)6-9-19(14)23(31)28-21-12-26-30(22(21)25)13-16-4-7-18(33-3)8-5-16/h4-12H,13,25H2,1-3H3,(H,27,32)(H,28,31)

Standard InChI Key:  RDGWTLBJOVXIQQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   13.6420  -12.8513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0575  -12.1386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8822  -12.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6481  -11.4223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4408  -12.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1911  -12.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0968  -11.5829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2881  -11.4193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8170  -12.8478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9860  -13.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9840  -13.9723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7006  -14.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4153  -13.9720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4140  -13.1408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6979  -12.7312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2681  -14.3848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5561  -13.9721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1257  -12.7283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8395  -13.1400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8402  -13.9647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6231  -14.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1099  -13.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6256  -12.8868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8820  -12.1026    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9349  -13.5559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3484  -12.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1734  -12.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9369  -12.1270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5819  -13.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4062  -13.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4045  -12.1328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5817  -12.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1680  -11.4211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9096  -12.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 11 16  1  0
 16 17  1  0
 14 18  1  0
 18 19  1  0
 22 23  2  0
 20 21  2  0
 19 20  1  0
 21 22  1  0
 23 19  1  0
  2  4  2  0
 23 24  1  0
  3  5  1  0
 22 25  1  0
  6  7  1  0
 25 26  1  0
  8  3  2  0
 26 27  1  0
  7  8  1  0
 26 28  2  0
  1  9  1  0
 27 29  2  0
 29 30  1  0
 30  9  2  0
  5  6  2  0
  9 31  1  0
  2  3  1  0
 31 32  2  0
 32 27  1  0
  1  2  1  0
 32 33  1  0
 10 11  2  0
  6 34  1  0
M  END

Associated Targets(Human)

HS27 (243 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.49Molecular Weight (Monoisotopic): 460.1859AlogP: 3.63#Rotatable Bonds: 7
Polar Surface Area: 137.30Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.49CX Basic pKa: 2.69CX LogP: 2.88CX LogD: 2.88
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -2.10

References

1. Kim MH, Kim M, Yu H, Kim H, Yoo KH, Sim T, Hah JM..  (2011)  Structure based design and syntheses of amino-1H-pyrazole amide derivatives as selective Raf kinase inhibitors in melanoma cells.,  19  (6): [PMID:21353571] [10.1016/j.bmc.2011.01.067]

Source