N-(4-(5-Amino-1-(4-methoxybenzyl)-1H-pyrazol-4-ylcarbamoyl)-3-methylphenyl)-2-chloroisonicotinamide

ID: ALA1684794

PubChem CID: 53326263

Max Phase: Preclinical

Molecular Formula: C25H23ClN6O3

Molecular Weight: 490.95

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cn2ncc(NC(=O)c3cc(NC(=O)c4ccnc(Cl)c4)ccc3C)c2N)cc1

Standard InChI:  InChI=1S/C25H23ClN6O3/c1-15-3-6-18(30-24(33)17-9-10-28-22(26)11-17)12-20(15)25(34)31-21-13-29-32(23(21)27)14-16-4-7-19(35-2)8-5-16/h3-13H,14,27H2,1-2H3,(H,30,33)(H,31,34)

Standard InChI Key:  PTQGOVTVBLGATN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -8.9402  -17.3316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9382  -18.1598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2215  -18.5733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5112  -18.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5098  -17.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2271  -16.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6556  -18.5723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3686  -18.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7965  -16.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0854  -17.3275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0860  -18.1522    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2977  -18.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8109  -17.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2952  -17.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0389  -16.2901    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9859  -17.7434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724  -17.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7474  -17.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9840  -16.3145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3389  -17.7507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5147  -17.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1003  -17.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5163  -16.3203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3392  -16.3224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7528  -15.6086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1035  -18.4674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2785  -18.4690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1327  -19.1842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1353  -17.7553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2831  -19.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1274  -20.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9533  -20.6137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3669  -19.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9541  -19.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1919  -19.8936    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  3  4  2  0
 17 18  1  0
  4  5  1  0
 17 19  2  0
  5  6  2  0
 18 20  2  0
  6  1  1  0
 20 21  1  0
  2  7  1  0
 21 22  2  0
  7  8  1  0
 22 23  1  0
  5  9  1  0
 23 24  2  0
 24 18  1  0
  9 10  1  0
 24 25  1  0
 13 14  2  0
 21 26  1  0
 11 12  2  0
 26 27  1  0
 10 11  1  0
 27 28  1  0
 12 13  1  0
 27 29  2  0
 14 10  1  0
 28 30  2  0
 30 31  1  0
 14 15  1  0
 31 32  2  0
  1  2  2  0
 32 33  1  0
 13 16  1  0
 33 34  2  0
 34 28  1  0
  2  3  1  0
 33 35  1  0
M  END

Associated Targets(Human)

HS27 (243 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.95Molecular Weight (Monoisotopic): 490.1520AlogP: 4.38#Rotatable Bonds: 7
Polar Surface Area: 124.16Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.69CX LogP: 3.53CX LogD: 3.53
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -1.89

References

1. Kim MH, Kim M, Yu H, Kim H, Yoo KH, Sim T, Hah JM..  (2011)  Structure based design and syntheses of amino-1H-pyrazole amide derivatives as selective Raf kinase inhibitors in melanoma cells.,  19  (6): [PMID:21353571] [10.1016/j.bmc.2011.01.067]

Source