N-(4-(5-Amino-1-(4-methoxybenzyl)-1H-pyrazol-4-ylcarbamoyl)-3-methylphenyl)-2-(pyridin-4-yl)thiazole-4-carboxamide

ID: ALA1684795

PubChem CID: 53319686

Max Phase: Preclinical

Molecular Formula: C28H25N7O3S

Molecular Weight: 539.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cn2ncc(NC(=O)c3cc(NC(=O)c4ncc(-c5ccncc5)s4)ccc3C)c2N)cc1

Standard InChI:  InChI=1S/C28H25N7O3S/c1-17-3-6-20(33-27(37)28-31-15-24(39-28)19-9-11-30-12-10-19)13-22(17)26(36)34-23-14-32-35(25(23)29)16-18-4-7-21(38-2)8-5-18/h3-15H,16,29H2,1-2H3,(H,33,37)(H,34,36)

Standard InChI Key:  NPKQHQLGXKGLBK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    4.2110  -17.2941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2090  -18.1223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9256  -18.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6403  -18.1220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6390  -17.2908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9229  -16.8812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4931  -18.5348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7811  -18.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3507  -16.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0645  -17.2900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0652  -18.1147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8481  -18.3723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3349  -17.7048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8506  -17.0368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1070  -16.2526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1599  -17.7059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5734  -16.9920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3984  -16.9931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1619  -16.2770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8069  -17.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6312  -17.7147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0455  -17.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6295  -16.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8067  -16.2849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3930  -15.5711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0423  -18.4299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8673  -18.4315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2785  -19.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2812  -17.7178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9454  -19.8987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5575  -20.4518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2727  -20.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1027  -19.2334    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.0233  -20.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0170  -21.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7282  -21.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4461  -21.2099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4484  -20.3806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7366  -19.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17 19  2  0
  5  6  2  0
 18 20  2  0
  6  1  1  0
 20 21  1  0
  2  7  1  0
 21 22  2  0
  7  8  1  0
 22 23  1  0
  5  9  1  0
 23 24  2  0
 24 18  1  0
  9 10  1  0
 24 25  1  0
 13 14  2  0
 21 26  1  0
 11 12  2  0
 26 27  1  0
 10 11  1  0
 27 28  1  0
 12 13  1  0
 27 29  2  0
 32 33  1  0
 14 10  1  0
 30 31  1  0
 14 15  1  0
  1  2  2  0
 28 30  2  0
 31 32  2  0
 33 28  1  0
 13 16  1  0
  2  3  1  0
 34 35  2  0
 16 17  1  0
 35 36  1  0
  3  4  2  0
 36 37  2  0
 17 18  1  0
 37 38  1  0
  4  5  1  0
 38 39  2  0
 39 34  1  0
 32 34  1  0
M  END

Associated Targets(Human)

HS27 (243 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 539.62Molecular Weight (Monoisotopic): 539.1740AlogP: 4.85#Rotatable Bonds: 8
Polar Surface Area: 137.05Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.20CX Basic pKa: 3.81CX LogP: 3.39CX LogD: 3.39
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -1.61

References

1. Kim MH, Kim M, Yu H, Kim H, Yoo KH, Sim T, Hah JM..  (2011)  Structure based design and syntheses of amino-1H-pyrazole amide derivatives as selective Raf kinase inhibitors in melanoma cells.,  19  (6): [PMID:21353571] [10.1016/j.bmc.2011.01.067]

Source