The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(5-Amino-1-(4-methoxybenzyl)-1H-pyrazol-4-ylcarbamoyl)-3-methylphenyl)-2-(pyridin-4-yl)thiazole-4-carboxamide ID: ALA1684795
PubChem CID: 53319686
Max Phase: Preclinical
Molecular Formula: C28H25N7O3S
Molecular Weight: 539.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cn2ncc(NC(=O)c3cc(NC(=O)c4ncc(-c5ccncc5)s4)ccc3C)c2N)cc1
Standard InChI: InChI=1S/C28H25N7O3S/c1-17-3-6-20(33-27(37)28-31-15-24(39-28)19-9-11-30-12-10-19)13-22(17)26(36)34-23-14-32-35(25(23)29)16-18-4-7-21(38-2)8-5-18/h3-15H,16,29H2,1-2H3,(H,33,37)(H,34,36)
Standard InChI Key: NPKQHQLGXKGLBK-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
4.2110 -17.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2090 -18.1223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9256 -18.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6403 -18.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6390 -17.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9229 -16.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4931 -18.5348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7811 -18.1221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3507 -16.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0645 -17.2900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0652 -18.1147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8481 -18.3723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3349 -17.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8506 -17.0368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1070 -16.2526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1599 -17.7059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5734 -16.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3984 -16.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1619 -16.2770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8069 -17.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6312 -17.7147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0455 -17.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6295 -16.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8067 -16.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3930 -15.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0423 -18.4299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8673 -18.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2785 -19.1467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2812 -17.7178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9454 -19.8987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5575 -20.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2727 -20.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1027 -19.2334 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.0233 -20.3755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0170 -21.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7282 -21.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4461 -21.2099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4484 -20.3806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7366 -19.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 19 2 0
5 6 2 0
18 20 2 0
6 1 1 0
20 21 1 0
2 7 1 0
21 22 2 0
7 8 1 0
22 23 1 0
5 9 1 0
23 24 2 0
24 18 1 0
9 10 1 0
24 25 1 0
13 14 2 0
21 26 1 0
11 12 2 0
26 27 1 0
10 11 1 0
27 28 1 0
12 13 1 0
27 29 2 0
32 33 1 0
14 10 1 0
30 31 1 0
14 15 1 0
1 2 2 0
28 30 2 0
31 32 2 0
33 28 1 0
13 16 1 0
2 3 1 0
34 35 2 0
16 17 1 0
35 36 1 0
3 4 2 0
36 37 2 0
17 18 1 0
37 38 1 0
4 5 1 0
38 39 2 0
39 34 1 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 539.62Molecular Weight (Monoisotopic): 539.1740AlogP: 4.85#Rotatable Bonds: 8Polar Surface Area: 137.05Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.20CX Basic pKa: 3.81CX LogP: 3.39CX LogD: 3.39Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -1.61
References 1. Kim MH, Kim M, Yu H, Kim H, Yoo KH, Sim T, Hah JM.. (2011) Structure based design and syntheses of amino-1H-pyrazole amide derivatives as selective Raf kinase inhibitors in melanoma cells., 19 (6): [PMID:21353571 ] [10.1016/j.bmc.2011.01.067 ]