The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-Amino-1-(4-methoxybenzyl)-1H-pyrazol-4-yl)-5-(3-(2,6-dichlorophenyl)ureido)-2-methyl benzamide ID: ALA1684803
PubChem CID: 53318346
Max Phase: Preclinical
Molecular Formula: C26H24Cl2N6O3
Molecular Weight: 539.42
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cn2ncc(NC(=O)c3cc(NC(=O)Nc4c(Cl)cccc4Cl)ccc3C)c2N)cc1
Standard InChI: InChI=1S/C26H24Cl2N6O3/c1-15-6-9-17(31-26(36)33-23-20(27)4-3-5-21(23)28)12-19(15)25(35)32-22-13-30-34(24(22)29)14-16-7-10-18(37-2)11-8-16/h3-13H,14,29H2,1-2H3,(H,32,35)(H2,31,33,36)
Standard InChI Key: NSUZTBGRKOIXOR-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-8.4777 -8.7108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4757 -9.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7590 -9.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0487 -9.5387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0473 -8.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7646 -8.2979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1931 -9.9515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.9061 -9.5387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3340 -8.2949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6188 -8.7066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.6181 -9.5313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8352 -9.7890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3484 -9.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8327 -8.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5764 -7.6693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5234 -9.1226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1099 -8.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2849 -8.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5214 -7.6936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8764 -9.1299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0522 -9.1314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6378 -8.4169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0538 -7.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8767 -7.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2903 -6.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6410 -9.8466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1840 -9.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5953 -10.5630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5978 -9.1344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4203 -10.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8294 -11.2799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6537 -11.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0681 -10.5671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6522 -9.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8294 -9.8515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4152 -9.1381 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.4148 -11.9931 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17 18 1 0
4 5 1 0
17 19 2 0
5 6 2 0
18 20 2 0
6 1 1 0
20 21 1 0
2 7 1 0
21 22 2 0
7 8 1 0
22 23 1 0
5 9 1 0
23 24 2 0
24 18 1 0
9 10 1 0
24 25 1 0
13 14 2 0
21 26 1 0
11 12 2 0
26 27 1 0
10 11 1 0
27 28 1 0
12 13 1 0
27 29 2 0
14 10 1 0
28 30 1 0
30 31 2 0
14 15 1 0
31 32 1 0
1 2 2 0
32 33 2 0
13 16 1 0
33 34 1 0
2 3 1 0
34 35 2 0
35 30 1 0
16 17 1 0
35 36 1 0
3 4 2 0
31 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 539.42Molecular Weight (Monoisotopic): 538.1287AlogP: 6.03#Rotatable Bonds: 7Polar Surface Area: 123.30Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.28CX Basic pKa: 2.69CX LogP: 5.19CX LogD: 5.19Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.23Np Likeness Score: -1.86
References 1. Kim MH, Kim M, Yu H, Kim H, Yoo KH, Sim T, Hah JM.. (2011) Structure based design and syntheses of amino-1H-pyrazole amide derivatives as selective Raf kinase inhibitors in melanoma cells., 19 (6): [PMID:21353571 ] [10.1016/j.bmc.2011.01.067 ]