N-(5-Amino-1-(4-methoxybenzyl)-1H-pyrazol-4-yl)-5-(3-(2,6-dichlorophenyl)ureido)-2-methyl benzamide

ID: ALA1684803

PubChem CID: 53318346

Max Phase: Preclinical

Molecular Formula: C26H24Cl2N6O3

Molecular Weight: 539.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cn2ncc(NC(=O)c3cc(NC(=O)Nc4c(Cl)cccc4Cl)ccc3C)c2N)cc1

Standard InChI:  InChI=1S/C26H24Cl2N6O3/c1-15-6-9-17(31-26(36)33-23-20(27)4-3-5-21(23)28)12-19(15)25(35)32-22-13-30-34(24(22)29)14-16-7-10-18(37-2)11-8-16/h3-13H,14,29H2,1-2H3,(H,32,35)(H2,31,33,36)

Standard InChI Key:  NSUZTBGRKOIXOR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   -8.4777   -8.7108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4757   -9.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7590   -9.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0487   -9.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0473   -8.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7646   -8.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1931   -9.9515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9061   -9.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3340   -8.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6188   -8.7066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6181   -9.5313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8352   -9.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3484   -9.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8327   -8.4534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5764   -7.6693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5234   -9.1226    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1099   -8.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2849   -8.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5214   -7.6936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8764   -9.1299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0522   -9.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6378   -8.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0538   -7.6995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8767   -7.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2903   -6.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6410   -9.8466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1840   -9.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5953  -10.5630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5978   -9.1344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4203  -10.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8294  -11.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6537  -11.2815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0681  -10.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6522   -9.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8294   -9.8515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4152   -9.1381    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.4148  -11.9931    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  4  5  1  0
 17 19  2  0
  5  6  2  0
 18 20  2  0
  6  1  1  0
 20 21  1  0
  2  7  1  0
 21 22  2  0
  7  8  1  0
 22 23  1  0
  5  9  1  0
 23 24  2  0
 24 18  1  0
  9 10  1  0
 24 25  1  0
 13 14  2  0
 21 26  1  0
 11 12  2  0
 26 27  1  0
 10 11  1  0
 27 28  1  0
 12 13  1  0
 27 29  2  0
 14 10  1  0
 28 30  1  0
 30 31  2  0
 14 15  1  0
 31 32  1  0
  1  2  2  0
 32 33  2  0
 13 16  1  0
 33 34  1  0
  2  3  1  0
 34 35  2  0
 35 30  1  0
 16 17  1  0
 35 36  1  0
  3  4  2  0
 31 37  1  0
M  END

Associated Targets(Human)

HS27 (243 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 539.42Molecular Weight (Monoisotopic): 538.1287AlogP: 6.03#Rotatable Bonds: 7
Polar Surface Area: 123.30Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.28CX Basic pKa: 2.69CX LogP: 5.19CX LogD: 5.19
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.23Np Likeness Score: -1.86

References

1. Kim MH, Kim M, Yu H, Kim H, Yoo KH, Sim T, Hah JM..  (2011)  Structure based design and syntheses of amino-1H-pyrazole amide derivatives as selective Raf kinase inhibitors in melanoma cells.,  19  (6): [PMID:21353571] [10.1016/j.bmc.2011.01.067]

Source