N-(5-Amino-1-(4-methoxybenzyl)-1H-pyrazol-4-yl)-4-(3-(4-chlorophenyl)ureido)-2-methylbenzamide

ID: ALA1684808

PubChem CID: 53317061

Max Phase: Preclinical

Molecular Formula: C26H25ClN6O3

Molecular Weight: 504.98

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cn2ncc(NC(=O)c3ccc(NC(=O)Nc4ccc(Cl)cc4)cc3C)c2N)cc1

Standard InChI:  InChI=1S/C26H25ClN6O3/c1-16-13-20(31-26(35)30-19-7-5-18(27)6-8-19)9-12-22(16)25(34)32-23-14-29-33(24(23)28)15-17-3-10-21(36-2)11-4-17/h3-14H,15,28H2,1-2H3,(H,32,34)(H2,30,31,35)

Standard InChI Key:  AACWFAGQTUUBNQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   17.0844  -12.9596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0824  -13.7877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7990  -14.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5136  -13.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5123  -12.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7963  -12.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3666  -14.2002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6547  -13.7874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2239  -12.5437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9377  -12.9554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9384  -13.7800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7212  -14.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2079  -13.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7237  -12.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9801  -11.9182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0329  -13.3714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4463  -12.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2713  -12.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0349  -11.9425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6797  -13.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5039  -13.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9182  -12.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5022  -11.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6795  -11.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2659  -11.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7431  -12.6658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1556  -11.9514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9805  -11.9514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7432  -11.2370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3930  -12.6658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9780  -13.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3898  -14.0936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2156  -14.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6279  -13.3747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2138  -12.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6290  -14.8079    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  3  4  2  0
 17 18  1  0
  4  5  1  0
 17 19  2  0
  5  6  2  0
 18 20  2  0
  6  1  1  0
 20 21  1  0
  2  7  1  0
 21 22  2  0
  7  8  1  0
 22 23  1  0
  5  9  1  0
 23 24  2  0
 24 18  1  0
  9 10  1  0
 24 25  1  0
 13 14  2  0
 22 26  1  0
 11 12  2  0
 26 27  1  0
 10 11  1  0
 27 28  1  0
 12 13  1  0
 27 29  2  0
 14 10  1  0
 28 30  1  0
 30 31  2  0
 14 15  1  0
 31 32  1  0
  1  2  2  0
 32 33  2  0
 13 16  1  0
 33 34  1  0
  2  3  1  0
 34 35  2  0
 35 30  1  0
 16 17  1  0
 33 36  1  0
M  END

Associated Targets(Human)

HS27 (243 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 504.98Molecular Weight (Monoisotopic): 504.1677AlogP: 5.38#Rotatable Bonds: 7
Polar Surface Area: 123.30Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.25CX Basic pKa: 2.69CX LogP: 4.58CX LogD: 4.58
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.27Np Likeness Score: -1.77

References

1. Kim MH, Kim M, Yu H, Kim H, Yoo KH, Sim T, Hah JM..  (2011)  Structure based design and syntheses of amino-1H-pyrazole amide derivatives as selective Raf kinase inhibitors in melanoma cells.,  19  (6): [PMID:21353571] [10.1016/j.bmc.2011.01.067]

Source