N-(5-Amino-1-(4-methoxybenzyl)-1H-pyrazol-4-yl)-5-(3-cyclohexylureido)-2-methylbenzamide

ID: ALA1684810

PubChem CID: 53317063

Max Phase: Preclinical

Molecular Formula: C26H32N6O3

Molecular Weight: 476.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cn2ncc(NC(=O)c3cc(NC(=O)NC4CCCCC4)ccc3C)c2N)cc1

Standard InChI:  InChI=1S/C26H32N6O3/c1-17-8-11-20(30-26(34)29-19-6-4-3-5-7-19)14-22(17)25(33)31-23-15-28-32(24(23)27)16-18-9-12-21(35-2)13-10-18/h8-15,19H,3-7,16,27H2,1-2H3,(H,31,33)(H2,29,30,34)

Standard InChI Key:  VWUGMYCCMJKMSZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    4.4527  -17.9566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4507  -18.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1673  -19.1983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8820  -18.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8806  -17.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1646  -17.5437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7348  -19.1973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0227  -18.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5923  -17.5408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3062  -17.9525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3069  -18.7772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0898  -19.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5766  -18.3673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0923  -17.6993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3486  -16.9151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4016  -18.3684    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8151  -17.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6401  -17.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4036  -16.9395    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0486  -18.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8728  -18.3772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2872  -17.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8712  -16.9453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0483  -16.9474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6347  -16.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2840  -19.0924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1090  -19.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5203  -19.8088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5228  -18.3803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3453  -19.8100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7511  -20.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5725  -20.5305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9899  -19.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5798  -19.1016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7521  -19.0967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  3  4  2  0
 17 18  1  0
  4  5  1  0
 17 19  2  0
  5  6  2  0
 18 20  2  0
  6  1  1  0
 20 21  1  0
  2  7  1  0
 21 22  2  0
  7  8  1  0
 22 23  1  0
  5  9  1  0
 23 24  2  0
 24 18  1  0
  9 10  1  0
 24 25  1  0
 13 14  2  0
 21 26  1  0
 11 12  2  0
 26 27  1  0
 10 11  1  0
 27 28  1  0
 12 13  1  0
 27 29  2  0
 14 10  1  0
 28 30  1  0
 30 31  1  0
 14 15  1  0
  1  2  2  0
 13 16  1  0
  2  3  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Associated Targets(Human)

HS27 (243 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.58Molecular Weight (Monoisotopic): 476.2536AlogP: 4.54#Rotatable Bonds: 7
Polar Surface Area: 123.30Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 13.58CX Basic pKa: 2.69CX LogP: 3.76CX LogD: 3.76
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -1.77

References

1. Kim MH, Kim M, Yu H, Kim H, Yoo KH, Sim T, Hah JM..  (2011)  Structure based design and syntheses of amino-1H-pyrazole amide derivatives as selective Raf kinase inhibitors in melanoma cells.,  19  (6): [PMID:21353571] [10.1016/j.bmc.2011.01.067]

Source